5-Methyl-1-(1-((5-(3-(trifluoromethoxy)phenoxy)pyridin-3-yl)methyl)piperidin-4-yl)pyrimidine-2,4(1H,3H)-dione

ID: ALA4865732

PubChem CID: 164623245

Max Phase: Preclinical

Molecular Formula: C23H23F3N4O4

Molecular Weight: 476.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(C2CCN(Cc3cncc(Oc4cccc(OC(F)(F)F)c4)c3)CC2)c(=O)[nH]c1=O

Standard InChI:  InChI=1S/C23H23F3N4O4/c1-15-13-30(22(32)28-21(15)31)17-5-7-29(8-6-17)14-16-9-20(12-27-11-16)33-18-3-2-4-19(10-18)34-23(24,25)26/h2-4,9-13,17H,5-8,14H2,1H3,(H,28,31,32)

Standard InChI Key:  CIVCDVXSYVWNOK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    0.9451   -2.9592    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3579   -3.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7663   -2.9567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7762   -2.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7751   -3.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4831   -4.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1928   -3.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1899   -2.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4813   -2.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9011   -4.0784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6082   -3.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3168   -4.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0234   -3.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0225   -2.8516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3092   -2.4443    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6055   -2.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7315   -4.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4388   -3.6681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1462   -4.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8514   -3.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8547   -2.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1467   -2.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4354   -2.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5635   -2.4511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2693   -2.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9760   -2.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9824   -1.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2760   -1.2325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5631   -1.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6810   -2.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6927   -1.2411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8567   -1.2264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0670   -4.0794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6516   -4.0783    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 26 30  1  0
 27 31  2  0
 29 32  2  0
  5 33  1  0
 33  2  1  0
  2 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4865732

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

tmk Thymidylate kinase (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 476.46Molecular Weight (Monoisotopic): 476.1671AlogP: 3.77#Rotatable Bonds: 6
Polar Surface Area: 89.45Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.31CX Basic pKa: 7.26CX LogP: 3.23CX LogD: 2.99
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: -1.05

References

1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S..  (2021)  Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors.,  225  [PMID:34450493] [10.1016/j.ejmech.2021.113784]

Source