2-(3-fluoro-2-hydroxyphenyl)-6-methyl-3-(2-phenylethyl)-5-(phenylmethyl)-4(3H)-pyrimidinone

ID: ALA4866041

PubChem CID: 136334632

Max Phase: Preclinical

Molecular Formula: C26H23FN2O2

Molecular Weight: 414.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(F)c2O)n(CCc2ccccc2)c(=O)c1Cc1ccccc1

Standard InChI:  InChI=1S/C26H23FN2O2/c1-18-22(17-20-11-6-3-7-12-20)26(31)29(16-15-19-9-4-2-5-10-19)25(28-18)21-13-8-14-23(27)24(21)30/h2-14,30H,15-17H2,1H3

Standard InChI Key:  BFDADFMMNADXMI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   13.7835   -3.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7824   -3.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4904   -4.3610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2001   -3.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1973   -3.1289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4886   -2.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9049   -4.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9049   -5.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6124   -5.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3204   -5.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3165   -4.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6084   -3.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0743   -4.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4862   -1.9065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9034   -2.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6127   -3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3188   -2.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0265   -3.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7322   -2.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7295   -1.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0153   -1.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3126   -1.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0757   -2.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3681   -3.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6604   -2.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9533   -3.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9530   -3.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6658   -4.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3700   -3.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1974   -5.5856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6133   -6.4012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
  6 14  2  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  1 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  8 30  1  0
  9 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866041

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.48Molecular Weight (Monoisotopic): 414.1744AlogP: 4.90#Rotatable Bonds: 6
Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.70CX Basic pKa: 0.29CX LogP: 5.60CX LogD: 5.42
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.81

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source