The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-fluoro-2-hydroxyphenyl)-6-methyl-3-(2-phenylethyl)-5-(phenylmethyl)-4(3H)-pyrimidinone ID: ALA4866041
PubChem CID: 136334632
Max Phase: Preclinical
Molecular Formula: C26H23FN2O2
Molecular Weight: 414.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(-c2cccc(F)c2O)n(CCc2ccccc2)c(=O)c1Cc1ccccc1
Standard InChI: InChI=1S/C26H23FN2O2/c1-18-22(17-20-11-6-3-7-12-20)26(31)29(16-15-19-9-4-2-5-10-19)25(28-18)21-13-8-14-23(27)24(21)30/h2-14,30H,15-17H2,1H3
Standard InChI Key: BFDADFMMNADXMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
13.7835 -3.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7824 -3.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4904 -4.3610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2001 -3.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1973 -3.1289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4886 -2.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9049 -4.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9049 -5.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6124 -5.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3204 -5.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3165 -4.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6084 -3.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0743 -4.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4862 -1.9065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9034 -2.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6127 -3.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3188 -2.7123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0265 -3.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7322 -2.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7295 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0153 -1.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3126 -1.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0757 -2.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3681 -3.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6604 -2.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9533 -3.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9530 -3.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6658 -4.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3700 -3.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1974 -5.5856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6133 -6.4012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
2 13 1 0
6 14 2 0
5 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
1 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
8 30 1 0
9 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.48Molecular Weight (Monoisotopic): 414.1744AlogP: 4.90#Rotatable Bonds: 6Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.70CX Basic pKa: 0.29CX LogP: 5.60CX LogD: 5.42Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.81
References 1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW.. (2021) Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction., 12 (9.0): [PMID:34531948 ] [10.1021/acsmedchemlett.1c00187 ]