The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4866100
PubChem CID: 44233045
Max Phase: Preclinical
Molecular Formula: C28H32O6
Molecular Weight: 464.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(c1ccc(Oc2ccc(OCCO)cc2)cc1)C1COC2(OO1)C1CC3CC(C1)CC2C3
Standard InChI: InChI=1S/C28H32O6/c1-18(21-2-4-25(5-3-21)32-26-8-6-24(7-9-26)30-11-10-29)27-17-31-28(34-33-27)22-13-19-12-20(15-22)16-23(28)14-19/h2-9,19-20,22-23,27,29H,1,10-17H2
Standard InChI Key: UUPJQSNURRTTJT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
16.5351 -7.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8894 -8.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7292 -7.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1798 -7.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9784 -7.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4308 -8.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7265 -8.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1657 -9.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8889 -8.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4197 -8.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2820 -8.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2808 -9.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9957 -10.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7121 -9.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7093 -8.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9939 -8.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4222 -8.5188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1382 -8.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1380 -9.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8532 -10.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5671 -9.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5613 -8.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8455 -8.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5661 -10.1769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8519 -9.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1371 -10.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4229 -9.7628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2837 -10.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2879 -10.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9960 -9.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7095 -10.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4197 -9.7403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7033 -8.5039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9868 -8.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
12 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
21 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
30 34 1 0
31 32 1 0
32 10 1 0
10 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.56Molecular Weight (Monoisotopic): 464.2199AlogP: 5.36#Rotatable Bonds: 7Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.50CX LogD: 5.50Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: 0.68
References 1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V.. (2021) Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis., 49 [PMID:34365007 ] [10.1016/j.bmcl.2021.128305 ]