NA

ID: ALA4866100

PubChem CID: 44233045

Max Phase: Preclinical

Molecular Formula: C28H32O6

Molecular Weight: 464.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2ccc(OCCO)cc2)cc1)C1COC2(OO1)C1CC3CC(C1)CC2C3

Standard InChI:  InChI=1S/C28H32O6/c1-18(21-2-4-25(5-3-21)32-26-8-6-24(7-9-26)30-11-10-29)27-17-31-28(34-33-27)22-13-19-12-20(15-22)16-23(28)14-19/h2-9,19-20,22-23,27,29H,1,10-17H2

Standard InChI Key:  UUPJQSNURRTTJT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   16.5351   -7.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8894   -8.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7292   -7.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1798   -7.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9784   -7.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4308   -8.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7265   -8.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1657   -9.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8889   -8.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4197   -8.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2820   -8.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2808   -9.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9957  -10.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7121   -9.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7093   -8.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9939   -8.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4222   -8.5188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1382   -8.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1380   -9.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8532  -10.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5671   -9.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5613   -8.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8455   -8.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5661  -10.1769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8519   -9.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1371  -10.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4229   -9.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2837  -10.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2879  -10.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9960   -9.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7095  -10.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4197   -9.7403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7033   -8.5039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9868   -8.9183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 12 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 30 34  1  0
 31 32  1  0
 32 10  1  0
 10 33  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.56Molecular Weight (Monoisotopic): 464.2199AlogP: 5.36#Rotatable Bonds: 7
Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: 0.68

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source