The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(6-amino-5-(1-oxo-1,2,3,4-tetrahydroisoquinolin-6-yl)pyridin-3-yl)benzenesulfonamide ID: ALA4866143
PubChem CID: 122588312
Max Phase: Preclinical
Molecular Formula: C20H18N4O3S
Molecular Weight: 394.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncc(-c2cccc(S(N)(=O)=O)c2)cc1-c1ccc2c(c1)CCNC2=O
Standard InChI: InChI=1S/C20H18N4O3S/c21-19-18(13-4-5-17-14(8-13)6-7-23-20(17)25)10-15(11-24-19)12-2-1-3-16(9-12)28(22,26)27/h1-5,8-11H,6-7H2,(H2,21,24)(H,23,25)(H2,22,26,27)
Standard InChI Key: MKDAADZCSDCLHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
12.2805 -3.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2805 -4.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4287 -8.5678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4329 -4.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4287 -6.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1447 -4.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7210 -7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8608 -4.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8608 -3.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7251 -5.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5769 -3.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4329 -3.6258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4370 -6.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5810 -4.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7251 -4.8593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7167 -8.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1447 -5.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1465 -7.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1530 -8.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8670 -8.5397 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8754 -9.3592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5724 -8.1227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5727 -8.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9950 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7095 -4.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7095 -3.6051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9950 -3.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9950 -2.3676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 3 2 0
15 4 1 0
14 2 1 0
5 10 1 0
6 8 1 0
10 15 2 0
7 16 1 0
1 11 1 0
19 3 1 0
11 9 2 0
4 6 2 0
4 12 1 0
9 8 1 0
13 7 2 0
17 5 2 0
13 5 1 0
18 13 1 0
6 17 1 0
8 14 2 0
18 19 2 0
19 20 1 0
20 21 2 0
20 22 1 0
20 23 2 0
1 27 1 0
1 2 2 0
2 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.46Molecular Weight (Monoisotopic): 394.1100AlogP: 1.93#Rotatable Bonds: 3Polar Surface Area: 128.17Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.14CX Basic pKa: 5.98CX LogP: 1.54CX LogD: 1.52Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: -0.51
References 1. (2020) STK4 inhibitors for treatment of hematologic malignancies,