2,5-Dimethyl-N-[4-([1,2,4]triazolo[4,3-a]quinoxalin-4-yloxy)-phenyl]-benzenesulfonamide

ID: ALA4866155

PubChem CID: 164625592

Max Phase: Preclinical

Molecular Formula: C23H19N5O3S

Molecular Weight: 445.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C)c(S(=O)(=O)Nc2ccc(Oc3nc4ccccc4n4cnnc34)cc2)c1

Standard InChI:  InChI=1S/C23H19N5O3S/c1-15-7-8-16(2)21(13-15)32(29,30)27-17-9-11-18(12-10-17)31-23-22-26-24-14-28(22)20-6-4-3-5-19(20)25-23/h3-14,27H,1-2H3

Standard InChI Key:  FNVLOLWHPGUCPD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   28.3369   -9.4957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7536  -10.0831    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.5540  -10.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0462   -9.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0600   -8.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3542   -8.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6326   -8.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6190   -9.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3268  -10.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7570  -10.9154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8959  -10.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4706  -11.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1845  -10.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9022  -11.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9018  -12.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1919  -12.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4742  -12.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6195  -12.5567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3404  -14.6201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3367  -13.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6231  -13.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9092  -13.7974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9087  -14.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1989  -15.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2026  -15.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9160  -16.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6301  -15.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6263  -15.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6079  -14.2019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1202  -13.5345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1261  -14.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7820   -8.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
  8 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 19 28  1  0
 23 28  2  0
 29 30  1  0
 29 31  2  0
 19 31  1  0
 20 30  2  0
 18 21  1  0
 15 18  1  0
 10 12  1  0
  5 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866155

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 445.50Molecular Weight (Monoisotopic): 445.1209AlogP: 4.49#Rotatable Bonds: 5
Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.09CX Basic pKa: 1.04CX LogP: 3.60CX LogD: 3.52
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -2.00

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source