1'-(4-(dimethylamino)benzylideneamino)-5'-oxo-1',5'-dihydro-10H-spiro[acridine-9,2'-pyrrole]-4'-carbonitrile

ID: ALA4866158

PubChem CID: 164625593

Max Phase: Preclinical

Molecular Formula: C26H21N5O

Molecular Weight: 419.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(/C=N\N2C(=O)C(C#N)=CC23c2ccccc2Nc2ccccc23)cc1

Standard InChI:  InChI=1S/C26H21N5O/c1-30(2)20-13-11-18(12-14-20)17-28-31-25(32)19(16-27)15-26(31)21-7-3-5-9-23(21)29-24-10-6-4-8-22(24)26/h3-15,17,29H,1-2H3/b28-17-

Standard InChI Key:  OLAOCMGIRUAHRG-QRQIAZFYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   12.4625  -14.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1750  -13.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9990  -12.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1775  -12.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8461  -13.5908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3196  -14.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3184  -15.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0332  -15.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0314  -14.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7469  -14.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7457  -15.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4586  -15.8005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1785  -14.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1769  -15.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8892  -15.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6037  -15.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6014  -14.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8884  -14.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0401  -13.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4846  -13.1568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7352  -12.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5395  -12.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7901  -11.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2344  -10.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4248  -10.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1779  -11.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7610  -12.1227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5464  -12.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0950  -11.6854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4839  -10.0170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2897   -9.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9276   -9.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8 11  2  0
 10  9  2  0
  9  6  1  0
 10 11  1  0
 10  1  1  0
 11 12  1  0
 12 14  1  0
 13  1  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  5 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  4 27  2  0
 28 29  3  0
  3 28  1  0
 24 30  1  0
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866158

    ---

Associated Targets(non-human)

Leishmania infantum (5912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.49Molecular Weight (Monoisotopic): 419.1746AlogP: 4.38#Rotatable Bonds: 3
Polar Surface Area: 71.73Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.17CX LogP: 4.39CX LogD: 4.39
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -0.55

References

1. Almeida FS, Sousa GLS, Rocha JC, Ribeiro FF, de Oliveira MR, de Lima Grisi TCS, Araújo DAM, de C Nobre MS, Castro RN, Amaral IPG, Keesen TSL, de Moura RO..  (2021)  In vitro anti-Leishmania activity and molecular docking of spiro-acridine compounds as potential multitarget agents against Leishmania infantum.,  49  [PMID:34311084] [10.1016/j.bmcl.2021.128289]

Source