5-Chloro-N-[4-(7,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yloxy)-phenyl]-2-methoxybenzenesulfonamide

ID: ALA4866180

PubChem CID: 164618829

Max Phase: Preclinical

Molecular Formula: C24H20ClN5O4S

Molecular Weight: 509.98

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(Oc2nc3cc(C)c(C)cc3n3cnnc23)cc1

Standard InChI:  InChI=1S/C24H20ClN5O4S/c1-14-10-19-20(11-15(14)2)30-13-26-28-23(30)24(27-19)34-18-7-5-17(6-8-18)29-35(31,32)22-12-16(25)4-9-21(22)33-3/h4-13,29H,1-3H3

Standard InChI Key:  IUTJESMFPKMALH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   10.4006  -14.4329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8133  -15.1428    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.2218  -14.4304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5368  -15.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2319  -15.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9523  -15.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9720  -16.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2770  -16.7363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5600  -16.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1145  -15.5513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2065  -14.2836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9037  -13.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4026  -15.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6963  -15.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9886  -15.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9829  -14.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6892  -13.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4011  -14.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2752  -13.9322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8683  -15.5722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5745  -15.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5689  -14.3415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8570  -13.9378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1549  -14.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4430  -13.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7367  -14.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7423  -15.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4501  -15.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1564  -15.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8513  -16.4519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1847  -15.7024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0404  -16.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0361  -15.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0290  -13.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3002  -17.5508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
  5 11  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 20 29  1  0
 24 29  2  0
 30 31  1  0
 30 32  2  0
 20 32  1  0
 21 31  2  0
 19 22  1  0
 27 33  1  0
 26 34  1  0
 16 19  1  0
 10 13  1  0
  8 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866180

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 509.98Molecular Weight (Monoisotopic): 509.0925AlogP: 5.15#Rotatable Bonds: 6
Polar Surface Area: 107.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.04CX Basic pKa: 1.46CX LogP: 4.04CX LogD: 3.63
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -1.85

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source