The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((7-(Dimethylamino)quinazolin-4-yl)oxy)phenyl)-3-((perfluorophenyl)methyl)urea ID: ALA4866196
PubChem CID: 155206359
Max Phase: Preclinical
Molecular Formula: C24H18F5N5O2
Molecular Weight: 503.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc2c(Oc3ccc(NC(=O)NCc4c(F)c(F)c(F)c(F)c4F)cc3)ncnc2c1
Standard InChI: InChI=1S/C24H18F5N5O2/c1-34(2)13-5-8-15-17(9-13)31-11-32-23(15)36-14-6-3-12(4-7-14)33-24(35)30-10-16-18(25)20(27)22(29)21(28)19(16)26/h3-9,11H,10H2,1-2H3,(H2,30,33,35)
Standard InChI Key: LJODAFJCYVGVPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
28.6333 -19.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6322 -19.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3443 -20.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3425 -18.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0553 -19.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0560 -19.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7646 -20.2902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4770 -19.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4722 -19.0490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7590 -18.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7547 -17.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4643 -17.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1737 -17.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8829 -17.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8790 -16.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1601 -16.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4538 -16.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5881 -16.1690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3027 -16.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0118 -16.1596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3081 -17.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9237 -20.2906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2167 -19.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9224 -21.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7211 -16.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4272 -16.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1361 -16.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8417 -16.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8388 -15.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1244 -14.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4218 -15.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7111 -14.9381 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.1182 -14.1112 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5442 -14.9214 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5508 -16.5580 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.1378 -17.3799 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
2 22 1 0
22 23 1 0
22 24 1 0
20 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 32 1 0
30 33 1 0
29 34 1 0
28 35 1 0
27 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.43Molecular Weight (Monoisotopic): 503.1381AlogP: 5.51#Rotatable Bonds: 6Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.95CX Basic pKa: 4.23CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -1.40
References 1. Lee KH, Yen WC, Lin WH, Wang PC, Lai YL, Su YC, Chang CY, Wu CS, Huang YC, Yang CM, Chou LH, Yeh TK, Chen CT, Shih C, Hsieh HP.. (2021) Discovery of BPR1R024, an Orally Active and Selective CSF1R Inhibitor that Exhibits Antitumor and Immunomodulatory Activity in a Murine Colon Tumor Model., 64 (19.0): [PMID:34606263 ] [10.1021/acs.jmedchem.1c01006 ]