The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(4-(4-(2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)ethyl)-1H-indole-5-carbonitrile ID: ALA4866210
PubChem CID: 118190876
Max Phase: Preclinical
Molecular Formula: C26H25N5O
Molecular Weight: 423.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2[nH]cc(CCN3CCN(c4ccc(-n5ccccc5=O)cc4)CC3)c2c1
Standard InChI: InChI=1S/C26H25N5O/c27-18-20-4-9-25-24(17-20)21(19-28-25)10-12-29-13-15-30(16-14-29)22-5-7-23(8-6-22)31-11-2-1-3-26(31)32/h1-9,11,17,19,28H,10,12-16H2
Standard InChI Key: XIZAWYVOUZWGDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
16.6217 -13.0518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4398 -13.1408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7774 -12.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1651 -11.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1651 -11.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4492 -10.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7334 -11.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7334 -11.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4492 -12.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4492 -9.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4492 -8.9459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5834 -12.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1364 -12.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9424 -12.6538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4956 -13.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3015 -13.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5545 -12.3132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0056 -11.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1996 -11.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3646 -12.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9178 -12.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7237 -12.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9767 -11.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4278 -11.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6176 -11.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3357 -12.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1418 -12.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3989 -11.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8458 -10.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0397 -10.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7868 -11.6278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0828 -13.0247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 3 0
6 10 1 0
12 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 1 0
26 32 2 0
23 31 1 0
17 20 1 0
13 14 1 0
3 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2059AlogP: 3.56#Rotatable Bonds: 5Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.36CX LogP: 3.82CX LogD: 2.81Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.43
References 1. Xu T, Xue Y, Lu J, Jin C.. (2021) Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs., 223 [PMID:34182358 ] [10.1016/j.ejmech.2021.113644 ]