3-(2-(4-(4-(2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)ethyl)-1H-indole-5-carbonitrile

ID: ALA4866210

PubChem CID: 118190876

Max Phase: Preclinical

Molecular Formula: C26H25N5O

Molecular Weight: 423.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCN3CCN(c4ccc(-n5ccccc5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C26H25N5O/c27-18-20-4-9-25-24(17-20)21(19-28-25)10-12-29-13-15-30(16-14-29)22-5-7-23(8-6-22)31-11-2-1-3-26(31)32/h1-9,11,17,19,28H,10,12-16H2

Standard InChI Key:  XIZAWYVOUZWGDE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   16.6217  -13.0518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4398  -13.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7774  -12.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1651  -11.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1651  -11.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4492  -10.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7334  -11.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7334  -11.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4492  -12.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4492   -9.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4492   -8.9459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5834  -12.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1364  -12.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9424  -12.6538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4956  -13.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3015  -13.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5545  -12.3132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0056  -11.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1996  -11.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3646  -12.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9178  -12.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7237  -12.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9767  -11.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4278  -11.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6176  -11.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3357  -12.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1418  -12.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3989  -11.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8458  -10.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0397  -10.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7868  -11.6278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0828  -13.0247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  1  0
 26 32  2  0
 23 31  1  0
 17 20  1  0
 13 14  1  0
  3 12  1  0
M  END

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2059AlogP: 3.56#Rotatable Bonds: 5
Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.36CX LogP: 3.82CX LogD: 2.81
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.43

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source