The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(6-(6-acetyl-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)pyridin-3-yl)piperazin-1-yl)acetonitrile ID: ALA4866230
PubChem CID: 164620548
Max Phase: Preclinical
Molecular Formula: C26H30N8O2
Molecular Weight: 486.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1c(C)c2cnc(Nc3ccc(N4CCN(CC#N)CC4)cn3)nc2n(C2CCCC2)c1=O
Standard InChI: InChI=1S/C26H30N8O2/c1-17-21-16-29-26(31-24(21)34(19-5-3-4-6-19)25(36)23(17)18(2)35)30-22-8-7-20(15-28-22)33-13-11-32(10-9-27)12-14-33/h7-8,15-16,19H,3-6,10-14H2,1-2H3,(H,28,29,30,31)
Standard InChI Key: YLFYRLARONEOML-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
33.1416 -2.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1416 -3.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8469 -4.0117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8469 -2.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5522 -2.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5506 -3.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2548 -4.0127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9611 -3.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9588 -2.7872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2540 -2.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4345 -4.0168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8469 -1.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4327 -2.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4303 -1.5663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7262 -2.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8514 -4.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1910 -5.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4447 -6.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2620 -6.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5132 -5.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6692 -4.0136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3765 -3.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0830 -4.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7898 -3.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7894 -2.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0763 -2.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3724 -2.7914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4962 -2.3779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2048 -2.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4943 -1.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2010 -1.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9097 -1.5574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6164 -1.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9116 -2.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3251 -1.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0324 -1.9626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 2 0
4 12 1 0
1 13 1 0
13 14 2 0
13 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
3 16 1 0
8 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
29 34 1 0
31 32 1 0
32 33 1 0
32 34 1 0
33 35 1 0
35 36 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.58Molecular Weight (Monoisotopic): 486.2492AlogP: 3.20#Rotatable Bonds: 6Polar Surface Area: 120.04Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.34CX Basic pKa: 4.11CX LogP: 2.69CX LogD: 2.69Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.38
References 1. Shan H, Ma X, Yan G, Luo M, Zhong X, Lan S, Yang J, Liu Y, Pu C, Tong Y, Li R.. (2021) Discovery of a novel covalent CDK4/6 inhibitor based on palbociclib scaffold., 219 [PMID:33857728 ] [10.1016/j.ejmech.2021.113432 ]