octyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate

ID: ALA4866269

PubChem CID: 164621774

Max Phase: Preclinical

Molecular Formula: C29H40N2O6

Molecular Weight: 512.65

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCCCCCCCOC(=O)N[C@H]1CCc2cc(OC)c(OC)c(OC)c2-c2ccc(NC)c(=O)cc21

Standard InChI:  InChI=1S/C29H40N2O6/c1-6-7-8-9-10-11-16-37-29(33)31-22-14-12-19-17-25(34-3)27(35-4)28(36-5)26(19)20-13-15-23(30-2)24(32)18-21(20)22/h13,15,17-18,22H,6-12,14,16H2,1-5H3,(H,30,32)(H,31,33)/t22-/m0/s1

Standard InChI Key:  GOQOMUORQUEEQE-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   15.4427  -11.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4415  -12.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1454  -13.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1437  -11.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8515  -12.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8523  -11.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4942  -11.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2953  -11.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6484  -12.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4942  -13.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2977  -13.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9469  -13.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1335  -14.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9521  -14.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4971  -14.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3061  -14.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4896  -15.7835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8918  -16.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6851  -14.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4615  -12.3925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1463  -14.0311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7376  -13.2171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7390  -11.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7388  -10.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0344  -12.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4431  -14.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8685  -11.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6857  -11.6821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4584  -10.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0959  -12.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9131  -12.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3232  -13.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1404  -13.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5506  -13.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1435  -14.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3263  -14.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9193  -15.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  5  2  0
  6  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  5 10  1  0
  7  8  1  0
  8  9  1  0
 11  9  1  0
 10 11  1  0
 11 12  2  0
 10 13  2  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 14 19  2  0
  9 20  1  6
  3 21  1  0
  2 22  1  0
  1 23  1  0
 23 24  1  0
 22 25  1  0
 21 26  1  0
 20 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4866269

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 512.65

Molecular Weight (Monoisotopic): 512.2886

AlogP: 5.86

#Rotatable Bonds: 12

Polar Surface Area: 95.12

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 3.80

CX LogP: 4.87

CX LogD: 4.87

Aromatic Rings: 2

Heavy Atoms: 37

QED Weighted: 0.34

Np Likeness Score: 0.48

References

1. Krzywik J, Aminpour M, Janczak J, Maj E, Moshari M, Mozga W, Wietrzyk J, Tuszyński JA, Huczyński A..  (2021)  An insight into the anticancer potential of carbamates and thiocarbamates of 10-demethoxy-10-methylaminocolchicine.,  215  [PMID:33611191] [10.1016/j.ejmech.2021.113282]

Source

Source(1):

• Scientific Literature