(2R,3S,4S,5R,6R)-2-((R)-1-aminoethyl)-6-(((1R,2R,3S,4R,6S)-4,6-diamino-2-(((2S,3R,4S,5R)-5-((S)-1-aminoethyl)-3,4-dihydroxytetrahydrofuran-2-yl)oxy)-3-hydroxycyclohexyl)oxy)tetrahydro-2H-pyran-3,4,5-triol

ID: ALA4866331

PubChem CID: 164624128

Max Phase: Preclinical

Molecular Formula: C19H38N4O10

Molecular Weight: 482.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](N)[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H]([C@@H](C)N)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C19H38N4O10/c1-4(20)14-10(26)9(25)12(28)18(30-14)32-16-7(23)3-6(22)8(24)17(16)33-19-13(29)11(27)15(31-19)5(2)21/h4-19,24-29H,3,20-23H2,1-2H3/t4-,5+,6-,7+,8+,9+,10+,11+,12-,13-,14-,15-,16-,17-,18-,19+/m1/s1

Standard InChI Key:  IBYMSLXKWFVQKW-CUZLWPGJSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   35.8549   -4.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2674   -5.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0924   -5.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5050   -4.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0924   -3.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2674   -3.6619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8549   -5.8055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5050   -5.8055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3300   -4.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5050   -2.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3300   -2.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0924   -2.2330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0299   -4.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6173   -3.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7923   -3.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3798   -2.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7923   -2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6173   -2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0299   -2.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5548   -2.9475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3798   -4.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0698   -3.7090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5548   -4.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0698   -5.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2852   -4.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2852   -3.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6177   -5.2739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3248   -5.8286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6177   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7040   -2.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8640   -3.8145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8549   -2.9475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3798   -1.5185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5680   -4.3704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.4370   -3.6600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.1989   -4.3704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.9130   -3.6600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  2  7  1  1
  3  8  1  6
  4  9  1  1
 10 11  1  0
 10 12  1  6
  5 10  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 19  1  0
 16 20  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 25 27  1  6
 24 28  1  6
 29 30  1  0
 29 31  1  1
 26 29  1  0
 23 21  1  1
 15 21  1  0
 19 32  1  6
 17 33  1  6
 13 14  1  0
  1 13  1  1
 26 34  1  6
 14 35  1  6
 15 36  1  1
  5 37  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4866331

    ---

Associated Targets(Human)

Premature termination codon (106 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.53Molecular Weight (Monoisotopic): 482.2588AlogP: -5.88#Rotatable Bonds: 6
Polar Surface Area: 262.38Molecular Species: BASEHBA: 14HBD: 10
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 14#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.94CX Basic pKa: 9.78CX LogP: -5.60CX LogD: -11.51
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: 1.25

References

1. Popadynec M, Baradaran-Heravi A, Alford B, Cameron SA, Clinch K, Mason JM, Rendle PM, Zubkova OV, Gan Z, Liu H, Rebollo O, Whitfield DM, Yan F, Roberge M, Powell DA..  (2021)  Reducing the Toxicity of Designer Aminoglycosides as Nonsense Mutation Readthrough Agents for Therapeutic Targets.,  12  (9.0): [PMID:34531957] [10.1021/acsmedchemlett.1c00349]

Source