The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S,E)-1-(benzylsulfonyl)-1-fluoro-5-phenylpent-1-en-3-ylamino)-1-oxo-3-p-tolylpropan-2-yl)isonicotinamide ID: ALA4866378
PubChem CID: 164625031
Max Phase: Preclinical
Molecular Formula: C34H34FN3O4S
Molecular Weight: 599.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C[C@H](NC(=O)c2ccncc2)C(=O)N[C@H](/C=C(\F)S(=O)(=O)Cc2ccccc2)CCc2ccccc2)cc1
Standard InChI: InChI=1S/C34H34FN3O4S/c1-25-12-14-27(15-13-25)22-31(38-33(39)29-18-20-36-21-19-29)34(40)37-30(17-16-26-8-4-2-5-9-26)23-32(35)43(41,42)24-28-10-6-3-7-11-28/h2-15,18-21,23,30-31H,16-17,22,24H2,1H3,(H,37,40)(H,38,39)/b32-23+/t30-,31-/m0/s1
Standard InChI Key: NAKRFJOZPXSONL-IMRRCPQVSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
45.7916 -6.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.3830 -5.5635 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
44.9740 -6.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6957 -5.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4075 -5.1549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1194 -5.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6957 -6.3889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9839 -5.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1194 -6.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8312 -5.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5430 -5.5676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2507 -5.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8312 -4.3336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8312 -6.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8267 -7.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5377 -8.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2464 -7.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2438 -6.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5363 -6.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9626 -5.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6744 -5.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2507 -4.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5430 -3.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5430 -3.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2528 -2.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2532 -1.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5449 -1.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8307 -1.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8339 -2.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6734 -4.3336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.9888 -4.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2778 -3.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5650 -4.3327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5676 -5.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2792 -5.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0888 -5.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8073 -5.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7990 -6.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.5074 -6.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.2227 -6.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.2253 -5.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.5163 -5.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9546 -8.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
4 7 2 0
4 8 1 0
6 9 1 6
6 10 1 0
10 11 1 0
11 12 1 0
10 13 2 0
9 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
20 21 2 0
21 2 1 0
12 22 1 1
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
8 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 8 1 0
2 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
17 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 599.73Molecular Weight (Monoisotopic): 599.2254AlogP: 5.27#Rotatable Bonds: 13Polar Surface Area: 105.23Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.69CX Basic pKa: 3.39CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -0.42
References 1. Jung S, Fuchs N, Johe P, Wagner A, Diehl E, Yuliani T, Zimmer C, Barthels F, Zimmermann RA, Klein P, Waigel W, Meyr J, Opatz T, Tenzer S, Distler U, Räder HJ, Kersten C, Engels B, Hellmich UA, Klein J, Schirmeister T.. (2021) Fluorovinylsulfones and -Sulfonates as Potent Covalent Reversible Inhibitors of the Trypanosomal Cysteine Protease Rhodesain: Structure-Activity Relationship, Inhibition Mechanism, Metabolism, and In Vivo Studies., 64 (16.0): [PMID:34378914 ] [10.1021/acs.jmedchem.1c01002 ]