2-(2-(benzylthio)-6-(4-chlorophenyl)pyrimidin-4-yl)-1H-benzo[d]imidazole

ID: ALA4866470

PubChem CID: 164620556

Max Phase: Preclinical

Molecular Formula: C24H17ClN4S

Molecular Weight: 428.95

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Clc1ccc(-c2cc(-c3nc4ccccc4[nH]3)nc(SCc3ccccc3)n2)cc1

Standard InChI:  InChI=1S/C24H17ClN4S/c25-18-12-10-17(11-13-18)21-14-22(23-26-19-8-4-5-9-20(19)27-23)29-24(28-21)30-15-16-6-2-1-3-7-16/h1-14H,15H2,(H,26,27)

Standard InChI Key:  GGULCGWHPSQJRX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   16.8253  -10.8670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8241  -11.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5322  -12.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2419  -11.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2390  -10.8634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5304  -10.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1207  -12.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3744  -11.7607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0346  -12.9063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9467  -12.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9466  -12.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6542  -13.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3622  -12.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3583  -12.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6502  -11.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2352  -13.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8276  -12.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0123  -12.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6036  -13.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0162  -13.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8301  -13.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5280   -9.6409    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.2345   -9.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0711  -13.3152    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.9434   -9.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9437  -10.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6517  -10.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3592  -10.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3541   -9.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6455   -9.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 17  1  0
 16  9  1  0
  9  7  1  0
  2  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  6 22  1  0
 22 23  1  0
 13 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866470

    ---

Associated Targets(non-human)

Botrytis cinerea (4183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sclerotinia sclerotiorum (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.95Molecular Weight (Monoisotopic): 428.0862AlogP: 6.63#Rotatable Bonds: 5
Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.35CX Basic pKa: 2.35CX LogP: 7.31CX LogD: 7.31
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.25Np Likeness Score: -1.42

References

1. Sun C, Zhang S, Qian P, Li Y, Deng H, Ren W, Jiang L..  (2021)  Synthesis and fungicidal activity of novel 2-(2-alkylthio-6-phenylpyrimidin-4-yl)-1H-benzimidazoles.,  47  [PMID:34157391] [10.1016/j.bmcl.2021.128210]

Source