5-Chloro-N-(4-((1-isopropyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)oxy)phenyl)-2-methoxybenzenesulfonamide

ID: ALA4866473

PubChem CID: 164620559

Max Phase: Preclinical

Molecular Formula: C25H22ClN5O4S

Molecular Weight: 524.00

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(Oc2nc3ccccc3n3c(C(C)C)nnc23)cc1

Standard InChI:  InChI=1S/C25H22ClN5O4S/c1-15(2)23-28-29-24-25(27-19-6-4-5-7-20(19)31(23)24)35-18-11-9-17(10-12-18)30-36(32,33)22-14-16(26)8-13-21(22)34-3/h4-15,30H,1-3H3

Standard InChI Key:  QDDMJURMBLDTJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   13.9712  -20.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3579  -13.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2479  -16.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3921  -16.7245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8931  -19.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8946  -17.7020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3818  -13.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6804  -18.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9695  -19.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6838  -20.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2504  -15.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5337  -15.0762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3938  -17.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3806  -18.3706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6788  -17.9635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3971  -19.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4702  -11.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0614  -12.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9646  -16.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3309  -14.4590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3987  -20.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6783  -14.3250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.8089  -13.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1104  -17.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7869  -13.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5305  -14.2476    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.1122  -18.7856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6796  -16.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4904  -12.5960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1073  -14.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6780  -15.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9613  -15.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1518  -19.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1138  -13.6602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6077  -20.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9519  -19.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  2  0
  8  9  1  0
 18  2  1  0
 11  3  2  0
 13 15  2  0
 25 29  1  0
 27 24  1  0
  5 33  1  0
 20 26  2  0
 23 25  1  0
 24 13  1  0
 10 21  2  0
 28 19  2  0
 32 31  2  0
 14  6  1  0
  7 30  1  0
 28  4  1  0
 19  3  1  0
 15  8  1  0
 25 18  2  0
 27 16  1  0
 12 11  1  0
 14  5  2  0
 31 28  1  0
 26 34  2  0
 23 30  2  0
 26 12  1  0
  9  1  2  0
 11 32  1  0
 27  5  1  0
 29 17  1  0
  8 16  2  0
 21 16  1  0
  1 10  1  0
 24  6  2  0
  7 22  1  0
  4 13  1  0
 23 26  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866473

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 524.00Molecular Weight (Monoisotopic): 523.1081AlogP: 5.66#Rotatable Bonds: 7
Polar Surface Area: 107.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.04CX Basic pKa: 1.44CX LogP: 4.38CX LogD: 3.97
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.79

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source