1-cyclopentyl-N-(6-(4-fluoro-2-(piperidin-1-yl)phenyl)pyridazin-3-yl)methanesulfonamide

ID: ALA4866526

PubChem CID: 164620929

Max Phase: Preclinical

Molecular Formula: C21H27FN4O2S

Molecular Weight: 418.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(CC1CCCC1)Nc1ccc(-c2ccc(F)cc2N2CCCCC2)nn1

Standard InChI:  InChI=1S/C21H27FN4O2S/c22-17-8-9-18(20(14-17)26-12-4-1-5-13-26)19-10-11-21(24-23-19)25-29(27,28)15-16-6-2-3-7-16/h8-11,14,16H,1-7,12-13,15H2,(H,24,25)

Standard InChI Key:  RMFRXMYBYCUYFU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   32.6464  -10.3676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2419   -9.6618    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.8329  -10.3650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3002  -10.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2991  -11.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0071  -12.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7168  -11.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7139  -10.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0053  -10.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4171  -10.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1266  -10.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8323  -10.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8296   -9.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1154   -9.2638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4127   -9.6767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4228  -12.1299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4221  -12.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1264  -13.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8359  -12.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8366  -12.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1278  -11.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5353   -9.2573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9507   -9.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5910  -12.1317    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.6595   -9.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7504  -10.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5501  -10.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9569   -9.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4084   -9.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  7 16  1  0
 13 22  1  0
 22  2  1  0
  2 23  1  0
  5 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866526

    ---

Associated Targets(Human)

KMO Tchem Kynurenine 3-monooxygenase (379 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.54Molecular Weight (Monoisotopic): 418.1839AlogP: 4.20#Rotatable Bonds: 6
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.06CX Basic pKa: 2.71CX LogP: 3.70CX LogD: 3.29
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.76Np Likeness Score: -1.46

References

1. Tsuboi K, Kimura H, Nakatsuji Y, Kassai M, Deai Y, Isobe Y..  (2021)  Discovery of N-(6-(5-fluoro-2-(piperidin-1-yl)phenyl)pyridazin-3-yl)-1-(tetrahydro-2H-pyran-4-yl)methanesulfonamide as a brain-permeable and metabolically stable kynurenine monooxygenase inhibitor.,  44  [PMID:34015507] [10.1016/j.bmcl.2021.128115]

Source