The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10S,13S)-N-((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)-2,12-dioxo-8-oxa-1,11-diazabicyclo[11.2.0]pentadecane-10-carboxamide ID: ALA4866610
PubChem CID: 164624581
Max Phase: Preclinical
Molecular Formula: C22H35N3O6
Molecular Weight: 437.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@@H]1COCCCCCC(=O)N2CC[C@H]2C(=O)N1)C(=O)[C@@]1(C)CO1
Standard InChI: InChI=1S/C22H35N3O6/c1-14(2)11-15(19(27)22(3)13-31-22)23-20(28)16-12-30-10-6-4-5-7-18(26)25-9-8-17(25)21(29)24-16/h14-17H,4-13H2,1-3H3,(H,23,28)(H,24,29)/t15-,16-,17-,22+/m0/s1
Standard InChI Key: SMYVVJLREYNLQH-ACTFIFLWSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
12.1097 -10.5982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8281 -10.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4211 -9.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7027 -9.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1179 -8.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5354 -9.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9503 -8.9424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5809 -10.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6571 -11.3642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2591 -10.0651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0072 -10.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6842 -9.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4340 -10.2751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6164 -9.1057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0874 -11.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1067 -9.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8599 -10.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9319 -10.9705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0346 -8.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2860 -10.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0138 -11.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2713 -11.7248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6650 -11.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8719 -12.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6526 -12.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2257 -12.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0063 -12.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5794 -11.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6940 -8.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5031 -8.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6892 -7.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2406 -9.4770 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
6 5 1 0
6 7 1 0
5 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
11 15 1 6
13 16 1 0
16 17 1 0
17 18 2 0
16 19 1 1
17 6 1 0
6 20 1 6
1 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
15 28 1 0
19 29 1 0
29 30 1 0
29 31 1 0
2 32 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.54Molecular Weight (Monoisotopic): 437.2526AlogP: 0.55#Rotatable Bonds: 6Polar Surface Area: 117.34Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.95CX Basic pKa: ┄CX LogP: 0.52CX LogD: 0.52Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: 0.47
References 1. Lee MJ, Bhattarai D, Jang H, Baek A, Yeo IJ, Lee S, Miller Z, Lee S, Hong JT, Kim DE, Lee W, Kim KB.. (2021) Macrocyclic Immunoproteasome Inhibitors as a Potential Therapy for Alzheimer's Disease., 64 (15.0): [PMID:34309393 ] [10.1021/acs.jmedchem.1c00291 ]