Ent-16-oxo-5-beta-(tosyloxy)methylbeyeran-19-oic acid

ID: ALA4866659

PubChem CID: 164625608

Max Phase: Preclinical

Molecular Formula: C28H38O6S

Molecular Weight: 502.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)OC[C@@H]2C(=O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)cc1

Standard InChI:  InChI=1S/C28H38O6S/c1-18-6-8-19(9-7-18)35(32,33)34-16-20-23(29)25(2)14-10-22-26(3)12-5-13-27(4,24(30)31)21(26)11-15-28(20,22)17-25/h6-9,20-22H,5,10-17H2,1-4H3,(H,30,31)/t20-,21+,22+,25+,26-,27-,28-/m1/s1

Standard InChI Key:  AXVGURFHRZXERW-IRYASSQUSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   20.5103  -12.2591    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.2026  -12.6887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2313  -11.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1081  -11.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7003  -12.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5175  -12.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4028  -10.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4028  -11.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1081   -9.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8134  -10.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8099  -11.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5120  -11.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2220  -11.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5189   -9.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2255  -10.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9374   -9.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9489   -9.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2424   -8.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5242   -9.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1096  -13.0088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3346  -12.2998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0962  -10.7762    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.5118  -10.7803    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.6618   -8.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8061   -9.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9275  -10.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6539   -9.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4444   -9.3598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3101  -11.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1268  -11.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0771  -12.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2610  -12.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8279  -13.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2114  -14.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0324  -14.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4619  -13.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7791  -15.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  4  5  1  1
  4  6  1  0
  7  8  1  0
  7  9  1  0
  8  4  1  0
  4 11  1  0
 10  9  1  0
 10 11  1  0
 10 14  1  0
 11 12  1  0
 12 13  1  0
 13 15  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  1
 16 17  1  0
 17 18  1  0
 18 19  1  0
  6 20  1  0
  6 21  2  0
 11 22  1  1
 14 23  1  1
 17 24  1  1
 10 25  1  6
 15 26  1  0
 17 27  1  0
 26 27  1  0
 27 28  2  0
 26 29  1  1
 29 30  1  0
 30  1  1  0
  1 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866659

    ---

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.67Molecular Weight (Monoisotopic): 502.2389AlogP: 5.38#Rotatable Bonds: 5
Polar Surface Area: 97.74Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.29CX Basic pKa: CX LogP: 6.33CX LogD: 3.36
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: 1.39

References

1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y..  (2021)  Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents.,  219  [PMID:33862515] [10.1016/j.ejmech.2021.113396]

Source