2-(3-fluoro-2-hydroxyphenyl)-6-methyl-5-(5-methyl-4-(pyridin-2-yl)thiophen-2-yl)-3phenethylpyrimidin-4(3H)-one

ID: ALA4866668

PubChem CID: 135930343

Max Phase: Preclinical

Molecular Formula: C29H24FN3O2S

Molecular Weight: 497.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(F)c2O)n(CCc2ccccc2)c(=O)c1-c1cc(-c2ccccn2)c(C)s1

Standard InChI:  InChI=1S/C29H24FN3O2S/c1-18-26(25-17-22(19(2)36-25)24-13-6-7-15-31-24)29(35)33(16-14-20-9-4-3-5-10-20)28(32-18)21-11-8-12-23(30)27(21)34/h3-13,15,17,34H,14,16H2,1-2H3

Standard InChI Key:  LPCZOMPPQPNCTF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    5.0709  -20.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0698  -21.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7820  -21.5674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4958  -21.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4929  -20.3271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7802  -19.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2047  -21.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2047  -22.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9163  -22.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6244  -22.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6204  -21.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9124  -21.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3576  -21.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7777  -19.1005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3590  -19.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2733  -19.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4698  -18.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0614  -19.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6084  -20.2556    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.2446  -19.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2032  -19.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9166  -20.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6228  -19.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3346  -20.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0444  -19.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0417  -19.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3234  -18.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6165  -19.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4931  -22.7961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9172  -23.6159    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1381  -18.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6200  -17.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2880  -16.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4703  -16.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9857  -17.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3244  -18.1005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
  6 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  1 15  1  0
 18 20  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  8 29  1  0
  9 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 17 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866668

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.1573AlogP: 6.41#Rotatable Bonds: 6
Polar Surface Area: 68.01Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.70CX Basic pKa: 3.89CX LogP: 6.67CX LogD: 6.49
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.01

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source