The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4866694
PubChem CID: 164618836
Max Phase: Preclinical
Molecular Formula: C34H46N2O5
Molecular Weight: 562.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OCCCCCC(=O)N3CCN(C)CC3)ccc21
Standard InChI: InChI=1S/C34H46N2O5/c1-33(2)22-28(26-13-11-24(38-6)20-30(26)40-33)29-23-34(3,4)41-31-21-25(12-14-27(29)31)39-19-9-7-8-10-32(37)36-17-15-35(5)16-18-36/h11-14,20-21H,7-10,15-19,22-23H2,1-6H3/b29-28+
Standard InChI Key: ZGXDDQOQWALRCK-ZQHSETAFSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
23.5541 -2.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3465 -2.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7680 -1.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5794 -5.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7622 -5.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1708 -6.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9336 -5.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9324 -5.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6405 -6.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6387 -4.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3473 -5.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3462 -5.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0524 -6.2613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7654 -5.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0547 -4.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0545 -3.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0601 -2.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3469 -3.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7660 -2.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7637 -3.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4629 -3.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1648 -3.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1631 -2.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4634 -2.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2244 -6.2628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5170 -5.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8699 -2.1730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5785 -2.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2853 -2.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9940 -2.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7007 -2.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4094 -2.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1161 -2.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8248 -2.5697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1141 -1.3456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8238 -3.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5284 -3.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2375 -3.3895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2375 -2.5714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5284 -2.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9447 -3.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 5 1 0
5 14 1 0
14 15 1 0
16 20 1 0
16 18 1 0
19 17 1 0
17 2 1 0
2 18 1 0
15 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 25 1 0
25 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
34 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.75Molecular Weight (Monoisotopic): 562.3407AlogP: 6.44#Rotatable Bonds: 8Polar Surface Area: 60.47Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.06CX LogP: 5.11CX LogD: 4.95Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.35Np Likeness Score: -0.15
References 1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A.. (2021) Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog., 50 [PMID:34469711 ] [10.1016/j.bmcl.2021.128340 ]