N-(6-(4-methylpyridin-3-yl)benzo[d]thiazol-2-yl)benzamide dihydrochloride

ID: ALA4866753

PubChem CID: 164620152

Max Phase: Preclinical

Molecular Formula: C20H17Cl2N3OS

Molecular Weight: 345.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccncc1-c1ccc2nc(NC(=O)c3ccccc3)sc2c1.Cl.Cl

Standard InChI:  InChI=1S/C20H15N3OS.2ClH/c1-13-9-10-21-12-16(13)15-7-8-17-18(11-15)25-20(22-17)23-19(24)14-5-3-2-4-6-14;;/h2-12H,1H3,(H,22,23,24);2*1H

Standard InChI Key:  URIJPWZJAUEPOZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   11.7670  -18.2339    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.5793  -16.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2957  -16.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2929  -15.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5775  -15.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0074  -16.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0073  -17.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7216  -18.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4364  -17.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4325  -16.9658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7176  -16.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8644  -16.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8656  -15.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0777  -15.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5894  -16.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0757  -16.8161    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.7644  -16.1436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3509  -16.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5258  -16.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7623  -17.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2930  -18.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1175  -16.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2932  -16.1384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8788  -16.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2948  -17.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1177  -17.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6930  -17.4240    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 12  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5 13  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
  7 21  1  0
 19 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 19  1  0
M  END

Associated Targets(Human)

PDGFRA Tclin Platelet-derived growth factor receptor alpha (5682 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KIT Tclin Stem cell growth factor receptor (10667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.43Molecular Weight (Monoisotopic): 345.0936AlogP: 4.92#Rotatable Bonds: 3
Polar Surface Area: 54.88Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.79CX Basic pKa: 5.53CX LogP: 4.83CX LogD: 4.83
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.57Np Likeness Score: -1.68

References

1. Kwon SH, Kim S, Park AY, Lee S, Gadhe CG, Seo BA, Park JS, Jo S, Oh Y, Kweon SH, Ma SX, Kim WR, Kim M, Kim H, Kim JE, Lee S, Lee J, Ko HS..  (2021)  A Novel, Selective c-Abl Inhibitor, Compound 5, Prevents Neurodegeneration in Parkinson's Disease.,  64  (20.0): [PMID:34583507] [10.1021/acs.jmedchem.1c01022]

Source