3-(4-(4-(4-(3,5-difluoro-2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)butyl)-1H-indole-5-carbonitrile

ID: ALA4866826

PubChem CID: 164622291

Max Phase: Preclinical

Molecular Formula: C28H28FN5O

Molecular Weight: 469.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(-n5cc(F)ccc5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C28H28FN5O/c29-23-5-11-28(35)34(20-23)25-8-6-24(7-9-25)33-15-13-32(14-16-33)12-2-1-3-22-19-31-27-10-4-21(18-30)17-26(22)27/h4-11,17,19-20,31H,1-3,12-16H2

Standard InChI Key:  BVVBEIKGHNTLIV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   21.5023  -15.7662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5864  -16.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8391  -16.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2954  -16.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4782  -16.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0696  -15.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4782  -14.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2954  -14.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7040  -15.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2524  -15.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4352  -15.5995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6724  -17.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2789  -18.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0663  -18.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6447  -18.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4362  -18.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6452  -17.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4367  -17.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0151  -17.9912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8019  -18.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0145  -18.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8024  -17.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0156  -16.9907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8030  -16.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3813  -17.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1723  -18.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3808  -18.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3819  -16.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1734  -16.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7517  -16.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5386  -17.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7471  -17.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1687  -17.1468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8035  -15.7770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1150  -18.0913    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 28 33  1  0
 28 34  2  0
 25 33  1  0
 19 22  1  0
 15 16  1  0
  3 12  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4866826

    ---

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.56Molecular Weight (Monoisotopic): 469.2278AlogP: 4.47#Rotatable Bonds: 7
Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.59CX LogP: 4.76CX LogD: 3.54
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.33

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source