The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-(4-(3,5-difluoro-2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)butyl)-1H-indole-5-carbonitrile ID: ALA4866826
PubChem CID: 164622291
Max Phase: Preclinical
Molecular Formula: C28H28FN5O
Molecular Weight: 469.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(-n5cc(F)ccc5=O)cc4)CC3)c2c1
Standard InChI: InChI=1S/C28H28FN5O/c29-23-5-11-28(35)34(20-23)25-8-6-24(7-9-25)33-15-13-32(14-16-33)12-2-1-3-22-19-31-27-10-4-21(18-30)17-26(22)27/h4-11,17,19-20,31H,1-3,12-16H2
Standard InChI Key: BVVBEIKGHNTLIV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
21.5023 -15.7662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5864 -16.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8391 -16.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2954 -16.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4782 -16.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0696 -15.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4782 -14.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2954 -14.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7040 -15.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2524 -15.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4352 -15.5995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6724 -17.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2789 -18.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0663 -18.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6447 -18.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4362 -18.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6452 -17.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4367 -17.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0151 -17.9912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8019 -18.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0145 -18.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8024 -17.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0156 -16.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8030 -16.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3813 -17.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1723 -18.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3808 -18.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3819 -16.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1734 -16.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7517 -16.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5386 -17.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7471 -17.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1687 -17.1468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8035 -15.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1150 -18.0913 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 3 0
6 10 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 1 0
28 34 2 0
25 33 1 0
19 22 1 0
15 16 1 0
3 12 1 0
31 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.56Molecular Weight (Monoisotopic): 469.2278AlogP: 4.47#Rotatable Bonds: 7Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 4.76CX LogD: 3.54Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.33
References 1. Xu T, Xue Y, Lu J, Jin C.. (2021) Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs., 223 [PMID:34182358 ] [10.1016/j.ejmech.2021.113644 ]