The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(6-amino-5-(1-oxo-1,2,3,4-tetrahydroisoquinolin-6-yl)pyridin-3-yl)-3-(benzyloxy)phenyl)cyclopropanesulfonamide ID: ALA4867030
PubChem CID: 122588180
Max Phase: Preclinical
Molecular Formula: C30H28N4O4S
Molecular Weight: 540.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncc(-c2ccc(NS(=O)(=O)C3CC3)cc2OCc2ccccc2)cc1-c1ccc2c(c1)CCNC2=O
Standard InChI: InChI=1S/C30H28N4O4S/c31-29-27(20-6-10-26-21(14-20)12-13-32-30(26)35)15-22(17-33-29)25-11-7-23(34-39(36,37)24-8-9-24)16-28(25)38-18-19-4-2-1-3-5-19/h1-7,10-11,14-17,24,34H,8-9,12-13,18H2,(H2,31,33)(H,32,35)
Standard InChI Key: LLJXDWBCSVQOIR-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
9.4018 -8.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4060 -4.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9512 -3.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4018 -6.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1158 -4.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6961 -7.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6735 -3.5866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8298 -4.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1200 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9678 -4.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8298 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9512 -2.3732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7002 -5.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5439 -3.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4060 -3.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4101 -6.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5480 -4.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7002 -4.8454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6818 -4.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6919 -8.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1241 -8.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1158 -5.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2496 -3.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2579 -4.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9903 -6.8966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2804 -7.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5747 -6.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4057 -9.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -9.7725 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.7039 -10.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3017 -11.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1189 -11.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9903 -9.3673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6919 -8.9520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5856 -6.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8807 -5.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1658 -6.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1603 -6.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8658 -7.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 10 1 0
20 1 2 0
23 24 2 0
18 2 1 0
17 24 1 0
23 3 1 0
4 13 1 0
5 8 1 0
9 21 2 0
19 7 1 0
13 18 2 0
6 20 1 0
23 14 1 0
21 1 1 0
14 11 2 0
10 19 1 0
2 5 2 0
2 15 1 0
11 8 1 0
16 6 2 0
22 4 2 0
3 12 2 0
7 3 1 0
16 4 1 0
9 16 1 0
5 22 1 0
8 17 2 0
6 25 1 0
25 26 1 0
26 27 1 0
1 28 1 0
28 29 1 0
29 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
29 33 2 0
29 34 2 0
27 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.65Molecular Weight (Monoisotopic): 540.1831AlogP: 4.77#Rotatable Bonds: 8Polar Surface Area: 123.41Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.56CX Basic pKa: 5.88CX LogP: 3.64CX LogD: 3.62Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.52
References 1. (2020) STK4 inhibitors for treatment of hematologic malignancies,