N-(4-(6-amino-5-(1-oxo-1,2,3,4-tetrahydroisoquinolin-6-yl)pyridin-3-yl)-3-(benzyloxy)phenyl)cyclopropanesulfonamide

ID: ALA4867030

PubChem CID: 122588180

Max Phase: Preclinical

Molecular Formula: C30H28N4O4S

Molecular Weight: 540.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncc(-c2ccc(NS(=O)(=O)C3CC3)cc2OCc2ccccc2)cc1-c1ccc2c(c1)CCNC2=O

Standard InChI:  InChI=1S/C30H28N4O4S/c31-29-27(20-6-10-26-21(14-20)12-13-32-30(26)35)15-22(17-33-29)25-11-7-23(34-39(36,37)24-8-9-24)16-28(25)38-18-19-4-2-1-3-5-19/h1-7,10-11,14-17,24,34H,8-9,12-13,18H2,(H2,31,33)(H,32,35)

Standard InChI Key:  LLJXDWBCSVQOIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    9.4018   -8.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4060   -4.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9512   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4018   -6.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1158   -4.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6961   -7.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6735   -3.5866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8298   -4.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1200   -7.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9678   -4.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8298   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9512   -2.3732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7002   -5.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5439   -3.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4060   -3.6155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4101   -6.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5480   -4.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7002   -4.8454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6818   -4.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6919   -8.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1241   -8.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1158   -5.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2496   -3.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2579   -4.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9903   -6.8966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2804   -7.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5747   -6.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4057   -9.3605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7000   -9.7725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7039  -10.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3017  -11.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1189  -11.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9903   -9.3673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6919   -8.9520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5856   -6.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8807   -5.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1658   -6.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1603   -6.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8658   -7.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 24 10  1  0
 20  1  2  0
 23 24  2  0
 18  2  1  0
 17 24  1  0
 23  3  1  0
  4 13  1  0
  5  8  1  0
  9 21  2  0
 19  7  1  0
 13 18  2  0
  6 20  1  0
 23 14  1  0
 21  1  1  0
 14 11  2  0
 10 19  1  0
  2  5  2  0
  2 15  1  0
 11  8  1  0
 16  6  2  0
 22  4  2  0
  3 12  2  0
  7  3  1  0
 16  4  1  0
  9 16  1  0
  5 22  1  0
  8 17  2  0
  6 25  1  0
 25 26  1  0
 26 27  1  0
  1 28  1  0
 28 29  1  0
 29 30  1  0
 31 30  1  0
 32 31  1  0
 30 32  1  0
 29 33  2  0
 29 34  2  0
 27 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867030

    ---

Associated Targets(Human)

STK4 Tchem Serine/threonine-protein kinase MST1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.65Molecular Weight (Monoisotopic): 540.1831AlogP: 4.77#Rotatable Bonds: 8
Polar Surface Area: 123.41Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.56CX Basic pKa: 5.88CX LogP: 3.64CX LogD: 3.62
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.52

References

1.  (2020)  STK4 inhibitors for treatment of hematologic malignancies, 

Source