4-(4-chloro-3-(morpholine-4-carbonyl)benzylamino)quinazoline-6-carbonitrile

ID: ALA4867033

PubChem CID: 118642132

Max Phase: Preclinical

Molecular Formula: C21H18ClN5O2

Molecular Weight: 407.86

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2ncnc(NCc3ccc(Cl)c(C(=O)N4CCOCC4)c3)c2c1

Standard InChI:  InChI=1S/C21H18ClN5O2/c22-18-3-1-15(10-16(18)21(28)27-5-7-29-8-6-27)12-24-20-17-9-14(11-23)2-4-19(17)25-13-26-20/h1-4,9-10,13H,5-8,12H2,(H,24,25,26)

Standard InChI Key:  MQZSJFVVSGBHEX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   16.3796  -15.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3784  -16.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0865  -17.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0847  -15.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7933  -15.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7921  -16.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4983  -17.1159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2102  -16.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2114  -15.8882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5006  -15.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6723  -15.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9645  -15.0734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5007  -14.6574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2084  -14.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2084  -13.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9171  -13.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9175  -12.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2093  -11.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4992  -12.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5023  -13.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2082  -10.9829    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.6254  -11.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3329  -12.2102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6258  -10.9841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3268  -13.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0302  -13.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7406  -13.0349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7429  -12.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0350  -11.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 17 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867033

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.86Molecular Weight (Monoisotopic): 407.1149AlogP: 3.24#Rotatable Bonds: 4
Polar Surface Area: 91.14Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.59CX LogP: 2.76CX LogD: 2.76
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -2.05

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source