The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-chloro-3-(morpholine-4-carbonyl)benzylamino)quinazoline-6-carbonitrile ID: ALA4867033
PubChem CID: 118642132
Max Phase: Preclinical
Molecular Formula: C21H18ClN5O2
Molecular Weight: 407.86
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2ncnc(NCc3ccc(Cl)c(C(=O)N4CCOCC4)c3)c2c1
Standard InChI: InChI=1S/C21H18ClN5O2/c22-18-3-1-15(10-16(18)21(28)27-5-7-29-8-6-27)12-24-20-17-9-14(11-23)2-4-19(17)25-13-26-20/h1-4,9-10,13H,5-8,12H2,(H,24,25,26)
Standard InChI Key: MQZSJFVVSGBHEX-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
16.3796 -15.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3784 -16.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0865 -17.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0847 -15.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7933 -15.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7921 -16.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4983 -17.1159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2102 -16.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2114 -15.8882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5006 -15.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6723 -15.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9645 -15.0734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5007 -14.6574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2084 -14.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2084 -13.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9171 -13.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9175 -12.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2093 -11.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4992 -12.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5023 -13.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2082 -10.9829 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.6254 -11.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3329 -12.2102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6258 -10.9841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3268 -13.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0302 -13.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7406 -13.0349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7429 -12.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0350 -11.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
11 12 3 0
1 11 1 0
10 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
17 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.86Molecular Weight (Monoisotopic): 407.1149AlogP: 3.24#Rotatable Bonds: 4Polar Surface Area: 91.14Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.59CX LogP: 2.76CX LogD: 2.76Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.71Np Likeness Score: -2.05
References 1. (2019) Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer,