The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-methyl-1H-indo1-3-yl)(1H-indol-3-yl)(4-(trifluoromethyl)phenyl)methylium methanesulfonate ID: ALA4867199
PubChem CID: 164625090
Max Phase: Preclinical
Molecular Formula: C26H21F3N2O3S
Molecular Weight: 403.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)[O-].Cn1cc([C+](c2ccc(C(F)(F)F)cc2)c2c[nH]c3ccccc23)c2ccccc21
Standard InChI: InChI=1S/C25H18F3N2.CH4O3S/c1-30-15-21(19-7-3-5-9-23(19)30)24(16-10-12-17(13-11-16)25(26,27)28)20-14-29-22-8-4-2-6-18(20)22;1-5(2,3)4/h2-15,29H,1H3;1H3,(H,2,3,4)/q+1;/p-1
Standard InChI Key: PXFDXVREKLYKIR-UHFFFAOYSA-M
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
9.0667 -14.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7851 -13.7482 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5037 -14.1630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3703 -13.0298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2000 -13.0298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6186 -6.7947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4981 -10.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5626 -9.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1147 -10.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9493 -10.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8336 -12.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0545 -11.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7480 -11.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0293 -7.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2040 -7.5091 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8606 -11.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3159 -8.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6399 -12.2145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3167 -11.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7474 -9.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0322 -10.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0319 -9.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5663 -10.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3075 -10.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2318 -12.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2039 -11.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7471 -8.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5011 -9.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0104 -11.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4254 -12.2156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7564 -10.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7451 -7.0919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3161 -9.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0313 -8.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9729 -12.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
2 5 2 0
30 29 1 0
21 22 1 0
19 23 1 0
19 25 2 0
33 17 1 0
13 21 1 0
26 10 1 0
14 15 1 0
11 13 2 0
17 34 2 0
24 23 2 0
29 23 1 0
18 11 1 0
9 16 1 0
28 24 1 0
31 8 1 0
25 30 1 0
13 7 1 0
34 14 1 0
7 31 2 0
16 12 2 0
14 32 1 0
22 33 2 0
27 20 2 0
6 14 1 0
29 26 2 0
22 20 1 0
21 19 1 0
34 27 1 0
10 28 2 0
8 9 2 0
7 12 1 0
18 12 1 0
18 35 1 0
M CHG 2 3 -1 21 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.43Molecular Weight (Monoisotopic): 403.1417AlogP: 6.70#Rotatable Bonds: 3Polar Surface Area: 20.72Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.33CX LogD: 3.33Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -0.55
References 1. Tu X, Chen X, Zhang D, Gao M, Liang J, Bao G, Zhang J, Peng S, Zhang X, Zeng Z, Su Y.. (2021) Optimization of novel oxidative DIMs as Nur77 modulators of the Nur77-Bcl-2 apoptotic pathway., 211 [PMID:33279290 ] [10.1016/j.ejmech.2020.113020 ] 2. Zhan, Yanyan Y and 22 more authors. 2008-09 Cytosporone B is an agonist for nuclear orphan receptor Nur77. [PMID:18690216 ]