The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2Z,6E)-ethyl 9-(6-(benzyloxy)-2-methylchroman-2-yl)-6-methyl-2-(2,2,2-trifluoroethoxy)nona-2,6-dienoate ID: ALA4867319
PubChem CID: 164622781
Max Phase: Preclinical
Molecular Formula: C31H37F3O5
Molecular Weight: 546.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C(=C/CC/C(C)=C/CCC1(C)CCc2cc(OCc3ccccc3)ccc2O1)OCC(F)(F)F
Standard InChI: InChI=1S/C31H37F3O5/c1-4-36-29(35)28(38-22-31(32,33)34)14-8-10-23(2)11-9-18-30(3)19-17-25-20-26(15-16-27(25)39-30)37-21-24-12-6-5-7-13-24/h5-7,11-16,20H,4,8-10,17-19,21-22H2,1-3H3/b23-11+,28-14-
Standard InChI Key: YVOYEJCEGZLSFO-GDFAGQPMSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
30.3585 -13.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3573 -14.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0654 -14.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0636 -12.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6493 -14.5378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7722 -13.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7710 -14.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4811 -14.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1970 -14.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1981 -13.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4835 -12.8928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9836 -13.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1912 -12.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5597 -12.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3497 -13.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9258 -12.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7158 -12.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6487 -15.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9406 -15.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2350 -15.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5274 -15.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5263 -16.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2387 -16.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9433 -16.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2919 -12.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0819 -12.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6580 -11.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7119 -11.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4479 -12.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0241 -11.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8140 -11.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3901 -11.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6618 -12.8237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4441 -11.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0202 -10.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8064 -9.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3825 -9.0893 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.0164 -9.4597 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5896 -8.8735 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 7 2 0
6 4 2 0
4 1 1 0
2 5 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
5 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
26 27 2 0
16 28 1 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
29 33 2 0
27 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.63Molecular Weight (Monoisotopic): 546.2593AlogP: 7.88#Rotatable Bonds: 13Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.04CX LogD: 8.04Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: 0.64
References 1. García A, Vila L, Marín P, Bernabeu Á, Villarroel-Vicente C, Hennuyer N, Staels B, Franck X, Figadère B, Cabedo N, Cortes D.. (2021) Synthesis of 2-Prenylated Alkoxylated Benzopyrans by Horner-Wadsworth-Emmons Olefination with PPARα/γ Agonist Activity., 12 (11.0): [PMID:34795868 ] [10.1021/acsmedchemlett.1c00400 ]