(2Z,6E)-ethyl 9-(6-(benzyloxy)-2-methylchroman-2-yl)-6-methyl-2-(2,2,2-trifluoroethoxy)nona-2,6-dienoate

ID: ALA4867319

PubChem CID: 164622781

Max Phase: Preclinical

Molecular Formula: C31H37F3O5

Molecular Weight: 546.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C(=C/CC/C(C)=C/CCC1(C)CCc2cc(OCc3ccccc3)ccc2O1)OCC(F)(F)F

Standard InChI:  InChI=1S/C31H37F3O5/c1-4-36-29(35)28(38-22-31(32,33)34)14-8-10-23(2)11-9-18-30(3)19-17-25-20-26(15-16-27(25)39-30)37-21-24-12-6-5-7-13-24/h5-7,11-16,20H,4,8-10,17-19,21-22H2,1-3H3/b23-11+,28-14-

Standard InChI Key:  YVOYEJCEGZLSFO-GDFAGQPMSA-N

Molfile:  

 
     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   30.3585  -13.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3573  -14.1298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0654  -14.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0636  -12.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6493  -14.5378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7722  -13.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7710  -14.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4811  -14.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1970  -14.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1981  -13.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4835  -12.8928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9836  -13.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1912  -12.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5597  -12.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3497  -13.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9258  -12.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7158  -12.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6487  -15.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9406  -15.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2350  -15.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5274  -15.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5263  -16.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2387  -16.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9433  -16.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2919  -12.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0819  -12.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6580  -11.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7119  -11.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4479  -12.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0241  -11.4554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8140  -11.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3901  -11.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6618  -12.8237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4441  -11.0371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.0202  -10.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8064   -9.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3825   -9.0893    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.0164   -9.4597    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5896   -8.8735    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  7  2  0
  6  4  2  0
  4  1  1  0
  2  5  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  1  0
 25 26  1  0
 26 27  2  0
 16 28  1  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 29 33  2  0
 27 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867319

    ---

Associated Targets(Human)

PPARA Tclin Peroxisome proliferator-activated receptor alpha (9197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.63Molecular Weight (Monoisotopic): 546.2593AlogP: 7.88#Rotatable Bonds: 13
Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 8.04CX LogD: 8.04
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: 0.64

References

1. García A, Vila L, Marín P, Bernabeu Á, Villarroel-Vicente C, Hennuyer N, Staels B, Franck X, Figadère B, Cabedo N, Cortes D..  (2021)  Synthesis of 2-Prenylated Alkoxylated Benzopyrans by Horner-Wadsworth-Emmons Olefination with PPARα/γ Agonist Activity.,  12  (11.0): [PMID:34795868] [10.1021/acsmedchemlett.1c00400]

Source