7-(3,5-Dimethylisoxazol-4-yl)-2-(4-methoxyphenethyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine

ID: ALA4867360

PubChem CID: 146524813

Max Phase: Preclinical

Molecular Formula: C29H38N4O2

Molecular Weight: 474.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCc2nc3cc(-c4c(C)noc4C)ccn3c2NC(C)(C)CC(C)(C)C)cc1

Standard InChI:  InChI=1S/C29H38N4O2/c1-19-26(20(2)35-32-19)22-15-16-33-25(17-22)30-24(14-11-21-9-12-23(34-8)13-10-21)27(33)31-29(6,7)18-28(3,4)5/h9-10,12-13,15-17,31H,11,14,18H2,1-8H3

Standard InChI Key:  PFHPOBBAWLVQAT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   40.4592  -14.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6709  -14.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8828  -15.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8742  -14.5438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4255  -15.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4246  -16.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1328  -16.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1305  -15.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8392  -15.5898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8443  -16.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6244  -16.6566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1015  -15.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6162  -15.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7210  -16.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9746  -16.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4275  -17.0968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8358  -17.8047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6352  -17.6351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8051  -15.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2423  -18.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9187  -15.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3317  -16.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1489  -16.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5577  -17.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3741  -17.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7791  -16.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3617  -15.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5466  -15.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5962  -16.6688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0102  -17.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9281  -13.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7278  -13.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9819  -12.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2733  -14.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5158  -13.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  6  1  0
  6  7  2  0
  7 10  1  0
  9  8  1  0
  8  5  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 13  4  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
  6 14  1  0
 15 19  1  0
 18 20  1  0
 12 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
  4  2  1  0
  2 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867360

    ---

Associated Targets(Human)

CREBBP Tchem CREB-binding protein (1602 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.65Molecular Weight (Monoisotopic): 474.2995AlogP: 7.03#Rotatable Bonds: 8
Polar Surface Area: 64.59Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.16CX LogP: 5.53CX LogD: 5.33
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.10

References

1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W..  (2021)  Development of Dimethylisoxazole-Attached Imidazo[1,2-a]pyridines as Potent and Selective CBP/P300 Inhibitors.,  64  (9.0): [PMID:33872011] [10.1021/acs.jmedchem.0c02232]

Source