The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3,5-Dimethylisoxazol-4-yl)-2-(4-isopropoxyphenethyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine ID: ALA4867382
PubChem CID: 164618850
Max Phase: Preclinical
Molecular Formula: C31H42N4O2
Molecular Weight: 502.70
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(C)c1-c1ccn2c(NC(C)(C)CC(C)(C)C)c(CCc3ccc(OC(C)C)cc3)nc2c1
Standard InChI: InChI=1S/C31H42N4O2/c1-20(2)36-25-13-10-23(11-14-25)12-15-26-29(33-31(8,9)19-30(5,6)7)35-17-16-24(18-27(35)32-26)28-21(3)34-37-22(28)4/h10-11,13-14,16-18,20,33H,12,15,19H2,1-9H3
Standard InChI Key: LDKVPEOVWHHRQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
24.2557 -25.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4674 -24.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6793 -25.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6707 -25.0022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2220 -26.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2211 -26.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9293 -27.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9270 -25.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6357 -26.0482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6408 -26.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4209 -27.1150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8980 -26.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4127 -25.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5175 -27.2808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7711 -26.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2240 -27.5552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6323 -28.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4317 -28.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6016 -26.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0388 -28.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7152 -26.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1282 -27.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9454 -27.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3542 -27.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1706 -27.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5756 -27.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1582 -26.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3431 -26.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3927 -27.1272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8067 -27.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7246 -24.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5243 -23.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7784 -23.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0698 -24.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3123 -23.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4034 -28.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6238 -27.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 6 1 0
6 7 2 0
7 10 1 0
9 8 1 0
8 5 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
13 4 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 14 2 0
6 14 1 0
15 19 1 0
18 20 1 0
12 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
4 2 1 0
2 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
30 36 1 0
30 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.70Molecular Weight (Monoisotopic): 502.3308AlogP: 7.81#Rotatable Bonds: 9Polar Surface Area: 64.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.16CX LogP: 6.30CX LogD: 6.11Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -1.20
References 1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W.. (2021) Development of Dimethylisoxazole-Attached Imidazo[1,2-a ]pyridines as Potent and Selective CBP/P300 Inhibitors., 64 (9.0): [PMID:33872011 ] [10.1021/acs.jmedchem.0c02232 ]