The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-(4-(5-oxo-1,6-naphthyridin-6(5H)-yl)phenyl)piperazin-1-yl)butyl)-1H-indole-5-carbonitrile ID: ALA4867414
PubChem CID: 118190855
Max Phase: Preclinical
Molecular Formula: C31H30N6O
Molecular Weight: 502.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(-n5ccc6ncccc6c5=O)cc4)CC3)c2c1
Standard InChI: InChI=1S/C31H30N6O/c32-21-23-6-11-29-28(20-23)24(22-34-29)4-1-2-14-35-16-18-36(19-17-35)25-7-9-26(10-8-25)37-15-12-30-27(31(37)38)5-3-13-33-30/h3,5-13,15,20,22,34H,1-2,4,14,16-19H2
Standard InChI Key: FGYLPIJGSRWQAL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
6.7638 -20.4207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5410 -20.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0212 -20.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5410 -19.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7118 -18.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1053 -18.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3281 -18.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1573 -19.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7638 -19.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2761 -17.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4427 -16.4059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8384 -20.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2470 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0641 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4727 -18.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2899 -18.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6985 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5157 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9243 -18.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5157 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6985 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7415 -18.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1501 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9673 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3759 -18.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9673 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1501 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6447 -18.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0533 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6447 -17.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8275 -17.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4189 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6017 -17.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1931 -18.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6017 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4189 -19.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8275 -18.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1931 -17.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 3 0
6 10 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
28 37 1 0
32 37 2 0
33 38 2 0
25 34 1 0
19 22 1 0
15 16 1 0
3 12 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.62Molecular Weight (Monoisotopic): 502.2481AlogP: 4.88#Rotatable Bonds: 7Polar Surface Area: 80.95Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 5.03CX LogD: 3.82Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -1.27
References 1. Xu T, Xue Y, Lu J, Jin C.. (2021) Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs., 223 [PMID:34182358 ] [10.1016/j.ejmech.2021.113644 ]