The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-((2-chlorophenyl)amino)-6-fluoro-1H-indazol-1-yl)-N-(tetrahydro-2H-pyran-4-yl)thiophene-2-carboxamide ID: ALA4867426
PubChem CID: 156155319
Max Phase: Preclinical
Molecular Formula: C23H20ClFN4O2S
Molecular Weight: 470.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CCOCC1)c1cc(-n2ncc3cc(Nc4ccccc4Cl)c(F)cc32)cs1
Standard InChI: InChI=1S/C23H20ClFN4O2S/c24-17-3-1-2-4-19(17)28-20-9-14-12-26-29(21(14)11-18(20)25)16-10-22(32-13-16)23(30)27-15-5-7-31-8-6-15/h1-4,9-13,15,28H,5-8H2,(H,27,30)
Standard InChI Key: MLEMAYBWCXSCBM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
15.1098 -22.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8216 -21.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3979 -21.6102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1098 -22.8442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5744 -21.9476 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.1212 -21.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7126 -20.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9092 -20.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0449 -19.8736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1798 -18.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6331 -19.1660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9273 -18.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8434 -19.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5109 -20.1924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2627 -19.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3430 -19.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6746 -18.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0913 -18.6915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1708 -17.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9187 -17.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9984 -16.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3293 -16.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5783 -16.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5021 -17.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5862 -18.0176 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.9304 -20.3336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.3979 -20.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1128 -20.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1147 -19.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4047 -19.1492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6911 -19.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6874 -20.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 2 2 0
7 9 1 0
9 13 1 0
12 10 1 0
10 11 2 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
15 26 1 0
3 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.96Molecular Weight (Monoisotopic): 470.0980AlogP: 5.53#Rotatable Bonds: 5Polar Surface Area: 68.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.15CX LogP: 4.21CX LogD: 4.21Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -1.75
References 1. Feng Y, Park H, Ryu JC, Yoon SO.. (2021) N -Aromatic-Substituted Indazole Derivatives as Brain-Penetrant and Orally Bioavailable JNK3 Inhibitors., 12 (10.0): [PMID:34676036 ] [10.1021/acsmedchemlett.1c00334 ]