The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1S,4S)-4-(2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)-5-methyl-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cyclohexyl)isobutyramide ID: ALA4867504
PubChem CID: 164630673
Max Phase: Preclinical
Molecular Formula: C30H41N7O3
Molecular Weight: 547.70
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(C)cc(=O)n([C@H]3CC[C@@H](NC(=O)C(C)C)CC3)c2n1
Standard InChI: InChI=1S/C30H41N7O3/c1-19(2)29(39)32-21-6-8-22(9-7-21)37-27(38)16-20(3)24-18-31-30(34-28(24)37)33-25-11-10-23(17-26(25)40-5)36-14-12-35(4)13-15-36/h10-11,16-19,21-22H,6-9,12-15H2,1-5H3,(H,32,39)(H,31,33,34)/t21-,22+
Standard InChI Key: DLRNDKPKZQIXMT-SZPZYZBQSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.9336 -11.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6445 -11.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6481 -10.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3518 -11.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9342 -12.2294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2305 -11.0006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2299 -10.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5226 -9.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5262 -8.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2370 -8.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9443 -8.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9408 -9.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1151 -7.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8224 -7.7298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5292 -7.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5327 -6.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8295 -6.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1187 -6.5009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2436 -6.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9509 -6.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9473 -7.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2365 -7.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6546 -7.7380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2471 -5.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4084 -7.7236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7011 -7.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9902 -7.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2870 -7.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2865 -6.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9973 -6.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7046 -6.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5833 -6.0810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8724 -6.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1651 -6.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1687 -5.2618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8754 -4.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5827 -5.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4614 -4.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9908 -8.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2799 -8.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
1 5 2 0
1 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
7 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 2 0
20 21 1 0
21 22 1 0
15 22 1 0
16 19 1 0
21 23 2 0
19 24 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
32 37 1 0
35 38 1 0
29 32 1 0
39 40 1 0
27 39 1 0
25 26 1 0
13 25 1 0
10 22 1 1
7 6 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.70Molecular Weight (Monoisotopic): 547.3271AlogP: 3.86#Rotatable Bonds: 7Polar Surface Area: 104.62Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.99CX Basic pKa: 7.84CX LogP: 3.72CX LogD: 3.14Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.46Np Likeness Score: -1.27
References 1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K.. (2021) Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors., 211 [PMID:33248853 ] [10.1016/j.ejmech.2020.113023 ]