The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Giffonin N ID: ALA4867521
PubChem CID: 164621826
Max Phase: Preclinical
Molecular Formula: C25H30O10
Molecular Weight: 490.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCc2ccc(O)c(c2)-c2cc(ccc2O)C[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C[C@@H]1O
Standard InChI: InChI=1S/C25H30O10/c26-11-21-22(31)23(32)24(33)25(35-21)34-14-7-13-3-5-18(28)16(9-13)15-8-12(1-4-17(15)27)2-6-19(29)20(30)10-14/h1,3-5,8-9,14,20-28,30-33H,2,6-7,10-11H2/t14-,20-,21+,22+,23-,24+,25+/m0/s1
Standard InChI Key: OPWQXWFCJIBIKW-OIYYJTSBSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
14.0807 -10.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0795 -11.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7876 -11.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4931 -11.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4903 -10.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7858 -10.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1938 -11.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1938 -12.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9013 -12.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6052 -12.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6013 -11.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8973 -11.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1923 -10.1178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8938 -10.5280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3715 -11.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3709 -12.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6864 -13.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8857 -13.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3050 -13.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5069 -13.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1646 -12.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7223 -13.0663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9675 -12.7532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3189 -13.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8612 -11.9430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5641 -12.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4578 -12.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1064 -11.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4252 -14.0606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9155 -13.4344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7030 -11.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0001 -10.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6487 -10.3224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1466 -14.3348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5187 -12.5987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1753 -13.5414 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
5 13 1 0
12 14 1 0
2 15 1 0
15 16 1 0
9 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
16 21 1 0
20 21 1 0
16 22 1 1
22 23 1 0
23 24 1 0
23 25 1 0
24 26 1 0
26 27 1 0
25 28 1 0
27 28 1 0
24 29 1 6
26 30 1 1
27 31 1 6
28 32 1 1
32 33 1 0
20 34 1 1
19 35 2 0
23 36 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.51Molecular Weight (Monoisotopic): 490.1839AlogP: -0.24#Rotatable Bonds: 3Polar Surface Area: 177.14Molecular Species: NEUTRALHBA: 10HBD: 7#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.92CX Basic pKa: ┄CX LogP: 0.52CX LogD: 0.51Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: 2.06
References 1. Masullo M, Lauro G, Cerulli A, Kontek B, Olas B, Bifulco G, Piacente S, Pizza C.. (2021) Giffonins, Antioxidant Diarylheptanoids from Corylus avellana , and Their Ability to Prevent Oxidative Changes in Human Plasma Proteins., 84 (3.0): [PMID:33616390 ] [10.1021/acs.jnatprod.0c01251 ]