(1R,5S,6r)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-3-(pyrrolidine-1-carbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxamide

ID: ALA4867524

PubChem CID: 164621827

Max Phase: Preclinical

Molecular Formula: C21H27N7O2

Molecular Weight: 409.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1CCN(c2nccn3ccnc23)C1)[C@H]1[C@@H]2CN(C(=O)N3CCCC3)C[C@@H]21

Standard InChI:  InChI=1S/C21H27N7O2/c29-20(17-15-12-28(13-16(15)17)21(30)26-6-1-2-7-26)24-14-3-8-27(11-14)19-18-22-4-9-25(18)10-5-23-19/h4-5,9-10,14-17H,1-3,6-8,11-13H2,(H,24,29)/t14-,15-,16+,17+/m0/s1

Standard InChI Key:  PDIXPDNUJSEQFO-MWDXBVQZSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
    7.3960  -19.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2132  -19.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4675  -18.6956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8046  -18.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1458  -18.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2360  -18.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8388  -18.9942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6136  -18.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7888  -17.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1829  -17.3975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4017  -17.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1846  -16.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4131  -16.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9347  -16.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3685  -18.4434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7615  -18.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9842  -18.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9317  -19.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1856  -18.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4384  -18.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7761  -17.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1139  -18.1341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3670  -18.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0146  -17.5490    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3955  -19.6993    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3366  -17.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1665  -17.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7294  -18.4287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9301  -18.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5216  -18.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0686  -19.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8150  -19.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867524

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.49Molecular Weight (Monoisotopic): 409.2226AlogP: 0.82#Rotatable Bonds: 3
Polar Surface Area: 86.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -1.18CX LogD: -1.18
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.81Np Likeness Score: -1.21

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source