2-(5-(1H-indol-3-yl)-1H-benzo[d][1,2,3]triazol-1-yl)acetamide

ID: ALA4867529

PubChem CID: 164622314

Max Phase: Preclinical

Molecular Formula: C16H13N5O

Molecular Weight: 291.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)Cn1nnc2ccc(-c3c[nH]c4ccccc34)cc21

Standard InChI:  InChI=1S/C16H13N5O/c17-16(22)9-21-15-7-10(5-6-14(15)19-20-21)12-8-18-13-4-2-1-3-11(12)13/h1-8,18H,9H2,(H2,17,22)

Standard InChI Key:  ARANKMFLRVYAIW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
   28.3774   -4.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3763   -4.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0843   -5.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0825   -3.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7911   -4.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7959   -4.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5760   -5.0751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0533   -4.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5682   -3.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8162   -2.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6163   -2.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5119   -1.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2675   -2.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3163   -1.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8614   -2.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6060   -1.6906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5210   -0.8801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7239   -0.7106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3136   -2.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3134   -2.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0210   -3.3254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6056   -3.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4867529

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 291.31Molecular Weight (Monoisotopic): 291.1120AlogP: 2.06#Rotatable Bonds: 3
Polar Surface Area: 89.59Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.39CX LogP: 1.84CX LogD: 1.84
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.61Np Likeness Score: -1.40

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source