Tert-butyl 3-((2R,4aS,6aS,12bR,14aS,14bR)-10-hydroxy-2,4a,6a,9,12b,14a-hexamethyl-11-oxo-1,2,3,4,4a,5,6,6a,11,12b,13,14,14a,14b-tetradecahydropicene-2-carboxamido)propylcarbamate

ID: ALA4867546

PubChem CID: 164622786

Max Phase: Preclinical

Molecular Formula: C37H54N2O5

Molecular Weight: 606.85

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)NCCCNC(=O)OC(C)(C)C)CC[C@]3(C)CC[C@]12C

Standard InChI:  InChI=1S/C37H54N2O5/c1-23-24-11-12-27-35(7,25(24)21-26(40)29(23)41)16-18-37(9)28-22-34(6,14-13-33(28,5)15-17-36(27,37)8)30(42)38-19-10-20-39-31(43)44-32(2,3)4/h11-12,21,28,41H,10,13-20,22H2,1-9H3,(H,38,42)(H,39,43)/t28-,33-,34-,35+,36-,37+/m1/s1

Standard InChI Key:  CGJWZWKBHJOVGL-MSTXUQNDSA-N

Molfile:  

 
     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
   37.6197   -0.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3296   -1.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3285   -0.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6175   -4.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0302   -4.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4386   -4.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0802   -7.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0791   -8.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7871   -9.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7854   -7.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4940   -7.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4947   -8.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2033   -9.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9115   -8.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3724   -7.3879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3711   -9.0239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7890   -9.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1977   -7.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9078   -7.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9003   -6.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1909   -6.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6104   -6.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6104   -7.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3183   -7.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0308   -7.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3183   -6.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0307   -6.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7415   -6.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7462   -5.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3167   -5.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6022   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2558   -4.2007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0279   -3.4967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4849   -6.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6022   -8.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7360   -6.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3121   -6.9626    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.6623   -3.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4795   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8859   -2.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7031   -2.7779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1095   -2.0689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9267   -2.0664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6988   -1.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1504   -1.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  5  6  1  6
  7  8  1  0
  8  9  2  0
  9 12  1  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 19  2  0
 18 11  1  0
  7 15  2  0
  8 16  1  0
  9 17  1  0
 18 19  1  0
 18 21  1  0
 19 23  1  0
 22 20  1  0
 20 21  1  0
 22 23  1  0
 22 26  1  0
 23 24  1  0
 24 25  1  0
 25 27  1  0
 26 27  1  0
 26 30  1  0
 27 28  1  0
 28 29  1  0
 29  5  1  0
  5 30  1  0
 22 31  1  6
  6 32  1  0
  6 33  2  0
 18 34  1  1
 23 35  1  1
 27 36  1  1
 26 37  1  1
 32 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 42 44  2  0
 43  2  1  0
  2 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4867546

    ---

Associated Targets(Human)

BEAS-2B (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 606.85Molecular Weight (Monoisotopic): 606.4033AlogP: 7.64#Rotatable Bonds: 5
Polar Surface Area: 104.73Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.75CX Basic pKa: 0.00CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: Heavy Atoms: 44QED Weighted: 0.28Np Likeness Score: 2.07

References

1. Coghi P, Ng JPL, Kadioglu O, Law BYK, Qiu AC, Saeed MEM, Chen X, Ip CK, Efferth T, Liu L, Wong VKW..  (2021)  Synthesis, computational docking and biological evaluation of celastrol derivatives as dual inhibitors of SERCA and P-glycoprotein in cancer therapy.,  224  [PMID:34256125] [10.1016/j.ejmech.2021.113676]

Source