N-(3-(Azepan-1-ylsulfonyl)-4-methylphenyl)-2-(4,5-dichloro-6-oxopyridazin-1(6H)-yl)acetamide

ID: ALA4867592

PubChem CID: 4798854

Max Phase: Preclinical

Molecular Formula: C19H22Cl2N4O4S

Molecular Weight: 473.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1S(=O)(=O)N1CCCCCC1

Standard InChI:  InChI=1S/C19H22Cl2N4O4S/c1-13-6-7-14(10-16(13)30(28,29)24-8-4-2-3-5-9-24)23-17(26)12-25-19(27)18(21)15(20)11-22-25/h6-7,10-11H,2-5,8-9,12H2,1H3,(H,23,26)

Standard InChI Key:  PDBOMFKGPSNJPR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    1.6037   -4.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0203   -3.9697    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.1951   -3.9651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7353   -4.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7341   -5.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4488   -5.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1650   -5.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1621   -4.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4470   -3.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0208   -3.1451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0195   -5.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8749   -3.9633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5906   -4.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3034   -3.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5938   -5.1978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0192   -4.3676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0192   -5.1913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7341   -5.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4479   -5.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4420   -4.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7266   -3.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7197   -3.1261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1533   -3.9392    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.1642   -5.5945    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2825   -2.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0973   -1.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7658   -2.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6072   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9483   -1.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4306   -1.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4  2  1  0
  2 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 16  1  0
 21 22  2  0
 20 23  1  0
 19 24  1  0
 10 25  1  0
 25 26  1  0
 10 27  1  0
 26 28  1  0
 27 29  1  0
 28 30  1  0
 29 30  1  0
M  END

Associated Targets(Human)

PRMT5 Tchem PRMT5/MEP50 complex (963 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRMT5 Tchem Protein arginine N-methyltransferase 5 (1273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.38Molecular Weight (Monoisotopic): 472.0739AlogP: 3.06#Rotatable Bonds: 5
Polar Surface Area: 101.37Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.68CX Basic pKa: CX LogP: 2.77CX LogD: 2.77
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -2.53

References

1. McKinney DC, McMillan BJ, Ranaghan MJ, Moroco JA, Brousseau M, Mullin-Bernstein Z, O'Keefe M, McCarren P, Mesleh MF, Mulvaney KM, Robinson F, Singh R, Bajrami B, Wagner FF, Hilgraf R, Drysdale MJ, Campbell AJ, Skepner A, Timm DE, Porter D, Kaushik VK, Sellers WR, Ianari A..  (2021)  Discovery of a First-in-Class Inhibitor of the PRMT5-Substrate Adaptor Interaction.,  64  (15.0): [PMID:34342224] [10.1021/acs.jmedchem.1c00507]

Source