4-(2-(7-(morpholine-4-carbonyl)naphthalen-2-yl)ethylamino)quinazoline-6-carbonitrile

ID: ALA4867633

PubChem CID: 71679653

Max Phase: Preclinical

Molecular Formula: C26H23N5O2

Molecular Weight: 437.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2ncnc(NCCc3ccc4ccc(C(=O)N5CCOCC5)cc4c3)c2c1

Standard InChI:  InChI=1S/C26H23N5O2/c27-16-19-2-6-24-23(14-19)25(30-17-29-24)28-8-7-18-1-3-20-4-5-21(15-22(20)13-18)26(32)31-9-11-33-12-10-31/h1-6,13-15,17H,7-12H2,(H,28,29,30)

Standard InChI Key:  OLKCMCDEDISPSK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.6677   -6.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6665   -6.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3746   -7.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3728   -5.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0814   -6.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0803   -6.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7865   -7.2312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4983   -6.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4995   -6.0035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7888   -5.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9604   -5.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2526   -5.1887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7888   -4.7727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4965   -4.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4965   -3.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2042   -3.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9089   -3.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9040   -1.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1996   -2.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6166   -2.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6151   -3.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3182   -3.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0233   -3.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0209   -2.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3172   -1.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7314   -3.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7323   -4.3643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4387   -3.1377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1484   -3.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8536   -3.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8569   -2.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1489   -1.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4376   -2.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 21  1  0
 20 18  1  0
 18 19  2  0
 19 16  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
 23 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1852AlogP: 3.78#Rotatable Bonds: 5
Polar Surface Area: 91.14Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 3.43CX LogD: 3.43
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.46

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source