The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 7-methyl-3-(3-(4-sulfamoylphenethyl)ureido)pyrazolo[1,5-a]pyrimidine-6-carboxylate ID: ALA4867657
PubChem CID: 164618855
Max Phase: Preclinical
Molecular Formula: C19H22N6O5S
Molecular Weight: 446.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cnc2c(NC(=O)NCCc3ccc(S(N)(=O)=O)cc3)cnn2c1C
Standard InChI: InChI=1S/C19H22N6O5S/c1-3-30-18(26)15-10-22-17-16(11-23-25(17)12(15)2)24-19(27)21-9-8-13-4-6-14(7-5-13)31(20,28)29/h4-7,10-11H,3,8-9H2,1-2H3,(H2,20,28,29)(H2,21,24,27)
Standard InChI Key: MMZBHZUVIYNBBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
22.5347 -8.0811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9474 -8.7910 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.3558 -8.0786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6517 -9.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6517 -10.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3569 -10.9041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3569 -9.2698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0622 -9.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0667 -10.4961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8419 -10.7434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3166 -10.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8347 -9.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3574 -11.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9437 -10.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2354 -10.5032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9449 -11.7279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5283 -10.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8200 -10.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0829 -8.6483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8813 -8.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1296 -7.6954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4315 -9.0783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2298 -8.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7800 -9.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5723 -9.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1196 -9.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9112 -9.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1529 -8.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5969 -8.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8073 -8.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5052 -9.3918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 2 0
5 6 2 0
6 9 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
6 13 1 0
14 15 1 0
14 16 2 0
5 14 1 0
15 17 1 0
17 18 1 0
12 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
25 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 2 1 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.49Molecular Weight (Monoisotopic): 446.1372AlogP: 1.23#Rotatable Bonds: 7Polar Surface Area: 157.78Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.16CX Basic pKa: 0.59CX LogP: 0.96CX LogD: 0.96Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.91
References 1. Gumus A, Bozdag M, Angeli A, Peat TS, Carta F, Supuran CT, Selleri S.. (2021) Privileged scaffolds in medicinal chemistry: Studies on pyrazolo[1,5-a]pyrimidines on sulfonamide containing Carbonic Anhydrase inhibitors., 49 [PMID:34371130 ] [10.1016/j.bmcl.2021.128309 ]