3-(3-(4-(4-(2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)propyl)-1H-indole-5-carbonitrile

ID: ALA4867688

PubChem CID: 118190850

Max Phase: Preclinical

Molecular Formula: C27H27N5O

Molecular Weight: 437.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCCN3CCN(c4ccc(-n5ccccc5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C27H27N5O/c28-19-21-6-11-26-25(18-21)22(20-29-26)4-3-12-30-14-16-31(17-15-30)23-7-9-24(10-8-23)32-13-2-1-5-27(32)33/h1-2,5-11,13,18,20,29H,3-4,12,14-17H2

Standard InChI Key:  GNEYFGFMJGANFQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    2.7786  -10.9410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5329  -10.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4481   -9.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6380   -9.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2256   -8.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4006   -8.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9882   -9.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4006  -10.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2256  -10.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9882   -8.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5757   -7.4739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0603   -9.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8449   -9.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4571   -8.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2418   -9.1934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4141   -9.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1987  -10.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8109   -9.7034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6386   -8.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8539   -8.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5955   -9.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7678  -10.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5524  -11.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1647  -10.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9922   -9.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2077   -9.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1216  -11.5294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9062  -11.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5184  -11.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3460  -10.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5615  -10.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9492  -10.7235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5052  -12.0783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  1  0
 27 33  2  0
 24 32  1  0
 18 21  1  0
 14 15  1  0
  3 12  1  0
M  END

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.55Molecular Weight (Monoisotopic): 437.2216AlogP: 3.95#Rotatable Bonds: 6
Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.58CX LogP: 4.27CX LogD: 3.06
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.39

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source