The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((6-Carboxy-2-(3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamido)benzo[d]thiazol-4-yl)oxy)ethyl)morpholin-4-ium chloride ID: ALA4867874
PubChem CID: 164619727
Max Phase: Preclinical
Molecular Formula: C20H21Cl3N4O5S
Molecular Weight: 499.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)Nc2nc3c(OCCN4CCOCC4)cc(C(=O)O)cc3s2)c(Cl)c1Cl.Cl
Standard InChI: InChI=1S/C20H20Cl2N4O5S.ClH/c1-10-14(21)15(22)17(23-10)18(27)25-20-24-16-12(8-11(19(28)29)9-13(16)32-20)31-7-4-26-2-5-30-6-3-26;/h8-9,23H,2-7H2,1H3,(H,28,29)(H,24,25,27);1H
Standard InChI Key: LQRPZEZHHWRIGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
7.8415 -5.2166 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.5539 -3.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2702 -3.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2674 -2.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5520 -2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8390 -3.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8402 -2.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0523 -2.3035 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5641 -2.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0502 -3.6447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7420 -2.9723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3305 -2.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5055 -2.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7440 -1.5434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0216 -1.5842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2367 -1.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2356 -2.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0198 -2.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5670 -3.1501 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.9804 -2.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6963 -2.5534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9772 -1.3187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2722 -3.7060 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.5699 -1.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5494 -4.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2617 -5.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2573 -5.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9696 -6.2870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9600 -7.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6682 -7.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3872 -7.1198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3935 -6.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6809 -5.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
9 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 13 2 0
17 19 1 0
4 20 1 0
20 21 1 0
20 22 2 0
18 23 1 0
16 24 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.38Molecular Weight (Monoisotopic): 498.0531AlogP: 3.90#Rotatable Bonds: 7Polar Surface Area: 116.78Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.46CX Basic pKa: 6.60CX LogP: 1.03CX LogD: 0.40Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -1.78
References 1. Durcik M, Nyerges Á, Skok Ž, Skledar DG, Trontelj J, Zidar N, Ilaš J, Zega A, Cruz CD, Tammela P, Welin M, Kimbung YR, Focht D, Benek O, Révész T, Draskovits G, Szili PÉ, Daruka L, Pál C, Kikelj D, Mašič LP, Tomašič T.. (2021) New dual ATP-competitive inhibitors of bacterial DNA gyrase and topoisomerase IV active against ESKAPE pathogens., 213 [PMID:33524686 ] [10.1016/j.ejmech.2021.113200 ]