N-(4-(4-Bromophenoxy)phenyl)-4-(2-((4-chlorobenzyl)amino)-2-oxoethoxy)benzamide

ID: ALA4867996

PubChem CID: 164623320

Max Phase: Preclinical

Molecular Formula: C28H22BrClN2O4

Molecular Weight: 565.85

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1ccc(C(=O)Nc2ccc(Oc3ccc(Br)cc3)cc2)cc1)NCc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C28H22BrClN2O4/c29-21-5-13-25(14-6-21)36-26-15-9-23(10-16-26)32-28(34)20-3-11-24(12-4-20)35-18-27(33)31-17-19-1-7-22(30)8-2-19/h1-16H,17-18H2,(H,31,33)(H,32,34)

Standard InChI Key:  LUQPXCREUMRWSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   18.1595   -3.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8692   -3.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8692   -2.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1577   -2.3357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4527   -2.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4527   -3.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7452   -2.3340    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.5775   -3.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2846   -3.5614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9930   -3.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7000   -3.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4084   -3.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1154   -3.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8210   -3.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5267   -3.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5267   -2.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8134   -2.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1154   -2.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2332   -2.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2332   -1.5097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9421   -2.7335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6486   -2.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3546   -2.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0588   -2.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0588   -1.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3449   -1.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6486   -1.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7647   -1.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4742   -1.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4742   -2.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1819   -2.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8888   -2.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8888   -1.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1735   -1.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5988   -2.7150    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   20.9930   -4.7861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  5  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 10 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4867996

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.85Molecular Weight (Monoisotopic): 564.0451AlogP: 6.84#Rotatable Bonds: 9
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.12CX Basic pKa: CX LogP: 6.40CX LogD: 6.40
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.42

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source