N-(2,3-Dimethylphenyl)-4-(2-((3,4-methylenedioxybenzyl)-amino)-2-oxoethoxy)benzamide

ID: ALA4868033

PubChem CID: 164618461

Max Phase: Preclinical

Molecular Formula: C25H24N2O5

Molecular Weight: 432.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)c2ccc(OCC(=O)NCc3ccc4c(c3)OCO4)cc2)c1C

Standard InChI:  InChI=1S/C25H24N2O5/c1-16-4-3-5-21(17(16)2)27-25(29)19-7-9-20(10-8-19)30-14-24(28)26-13-18-6-11-22-23(12-18)32-15-31-22/h3-12H,13-15H2,1-2H3,(H,26,28)(H,27,29)

Standard InChI Key:  DSFUZDOJWOOWGM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    2.2697   -6.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9794   -5.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9794   -5.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2679   -4.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5617   -5.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5617   -5.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7804   -6.2186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2987   -5.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7824   -4.8902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6877   -6.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3948   -5.9635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1031   -6.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8102   -5.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5185   -6.3687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2256   -5.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9311   -6.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369   -5.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369   -5.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9235   -4.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2256   -5.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3434   -4.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3434   -3.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0523   -5.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7588   -4.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4648   -5.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1708   -4.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1708   -3.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4551   -3.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7588   -3.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8795   -5.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4648   -5.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1031   -7.1881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
  5  9  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 26 30  1  0
 25 31  1  0
 12 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4868033

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.48Molecular Weight (Monoisotopic): 432.1685AlogP: 3.98#Rotatable Bonds: 7
Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.05CX Basic pKa: CX LogP: 4.18CX LogD: 4.18
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.39

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source