The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(5-chloro-2-((3,5-difluorophenyl)amino)pyrimidin-4-yl)-N-(3-((2-hydroxyethyl)carbamoyl)-4-(piperidin-1-yl)phenyl)pyrrolidine-2-carboxamide ID: ALA4868222
PubChem CID: 164624626
Max Phase: Preclinical
Molecular Formula: C29H32ClF2N7O3
Molecular Weight: 600.07
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCO)c1cc(NC(=O)[C@@H]2CCCN2c2nc(Nc3cc(F)cc(F)c3)ncc2Cl)ccc1N1CCCCC1
Standard InChI: InChI=1S/C29H32ClF2N7O3/c30-23-17-34-29(36-21-14-18(31)13-19(32)15-21)37-26(23)39-11-4-5-25(39)28(42)35-20-6-7-24(38-9-2-1-3-10-38)22(16-20)27(41)33-8-12-40/h6-7,13-17,25,40H,1-5,8-12H2,(H,33,41)(H,35,42)(H,34,36,37)/t25-/m0/s1
Standard InChI Key: ALZBQLSWJSFHDE-VWLOTQADSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
33.3984 -13.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2015 -13.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0605 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3967 -12.0524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9519 -10.6999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7544 -11.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3095 -12.3205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6237 -12.3246 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.1716 -11.0953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7847 -11.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1780 -11.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9994 -10.3770 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.7572 -11.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4473 -12.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6203 -11.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0566 -12.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6091 -12.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0105 -10.9265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6163 -10.6322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0432 -10.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5988 -11.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3344 -11.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0408 -9.8601 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.4683 -12.3235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8855 -12.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5979 -11.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3953 -11.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0450 -12.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0058 -11.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8376 -12.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2305 -11.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3356 -11.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8778 -10.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4471 -13.1119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2778 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8831 -14.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6610 -14.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8302 -13.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2215 -12.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7280 -10.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3377 -10.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1138 -10.7323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24 11 1 0
22 28 1 0
16 30 2 0
14 16 1 0
29 27 2 0
26 12 1 0
27 15 1 0
13 24 1 0
30 29 1 0
10 4 2 0
20 32 1 0
20 23 1 0
25 21 1 0
22 8 1 0
28 13 2 0
10 5 1 0
31 18 1 0
26 33 1 0
21 26 2 0
3 31 1 6
3 7 1 0
11 25 2 0
31 19 2 0
6 20 2 0
32 22 2 0
17 3 1 0
1 2 1 0
21 7 1 0
13 6 1 0
7 1 1 0
2 17 1 0
18 15 1 0
9 11 1 0
29 10 1 0
15 14 2 0
33 9 2 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
30 34 1 0
5 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.07Molecular Weight (Monoisotopic): 599.2223AlogP: 4.47#Rotatable Bonds: 9Polar Surface Area: 122.72Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.06CX Basic pKa: 4.41CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.28Np Likeness Score: -1.66
References 1. Li T, Li C, Yang J, Guo M, Cao Z, Wang X, Jiang N, Zhai X.. (2021) Discovery of novel 2-phenylamino-4-prolylpyrimidine derivatives as TRK/ALK dual inhibitors with promising antitumor effects., 47 [PMID:34534734 ] [10.1016/j.bmc.2021.116396 ]