(S)-1-(3,4-difluoro-5-methoxyphenyl)-1-((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)ethanol

ID: ALA4868293

PubChem CID: 164619348

Max Phase: Preclinical

Molecular Formula: C28H30F2N2O3

Molecular Weight: 480.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@](C)(O)c4cc(F)c(F)c(OC)c4)[C@@]2(C)C3)cc1

Standard InChI:  InChI=1S/C28H30F2N2O3/c1-27-15-17-16-31-32(20-8-10-21(34-3)11-9-20)23(17)13-18(27)6-5-7-25(27)28(2,33)19-12-22(29)26(30)24(14-19)35-4/h8-14,16,25,33H,5-7,15H2,1-4H3/t25-,27-,28-/m0/s1

Standard InChI Key:  XASPQXYKXFSVPK-MYKRZTLLSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   35.2428  -13.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0648  -13.1133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6573  -12.3994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0684  -15.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7819  -15.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7819  -14.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0684  -13.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3549  -15.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3575  -14.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6455  -13.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6444  -15.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9319  -15.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9307  -14.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1470  -14.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6663  -14.7740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1489  -15.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8999  -16.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0906  -16.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8378  -17.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3888  -17.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2003  -17.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4537  -16.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7822  -12.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8618  -13.7235    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.1354  -18.5787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4953  -13.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2122  -12.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2144  -11.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4937  -11.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7797  -11.8762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9230  -13.1185    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.9265  -11.4670    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.4926  -10.6404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2038  -10.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6856  -19.1892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3575  -13.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  9  7  1  0
  8  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  1  0
  9 10  1  0
 10 13  1  0
 12 11  1  0
 11  8  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 17  1  0
  7  2  1  0
  2 23  1  0
  7 24  1  6
 20 25  1  0
 23 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 23  1  0
 27 31  1  0
 28 32  1  0
 29 33  1  0
 33 34  1  0
 25 35  1  0
  9 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4868293

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.56Molecular Weight (Monoisotopic): 480.2224AlogP: 5.82#Rotatable Bonds: 5
Polar Surface Area: 56.51Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.90CX Basic pKa: 1.60CX LogP: 5.37CX LogD: 5.37
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: -0.09

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source