2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(pyridin-4-yl)acetamide

ID: ALA4868320

PubChem CID: 164620609

Max Phase: Preclinical

Molecular Formula: C21H15I2N5O4S2

Molecular Weight: 719.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccncc3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C21H15I2N5O4S2/c22-12-9-16-19(17(23)10-12)27-21(33-11-18(29)26-13-5-7-25-8-6-13)28(20(16)30)14-1-3-15(4-2-14)34(24,31)32/h1-10H,11H2,(H2,24,31,32)(H,25,26,29)

Standard InChI Key:  BYQTXOROXWBJLO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   32.6092   -9.0799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0220   -9.7898    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.4304   -9.0774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3497  -11.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3486  -12.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0566  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0548  -11.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7635  -11.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7623  -12.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4724  -12.6488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1882  -12.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1894  -11.4143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4747  -10.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6419  -11.0074    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   28.0563  -13.4616    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   29.4748  -10.1812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8964  -11.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6034  -11.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3116  -11.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3140  -10.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6024   -9.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8971  -10.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8948  -12.6501    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.7295  -10.1994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6036  -12.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3102  -12.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0190  -12.2475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3079  -13.4713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7256  -12.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7185  -13.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4243  -13.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1341  -13.4762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1338  -12.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4275  -12.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868320

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 719.32Molecular Weight (Monoisotopic): 718.8655AlogP: 3.37#Rotatable Bonds: 6
Polar Surface Area: 137.04Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: 5.65CX LogP: 3.88CX LogD: 3.87
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: -2.22

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source