The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((3,4-Dimethoxybenzyl)amino)-2-oxoethoxy)-N-(2,3-dimethylphenyl)benzamide ID: ALA4868365
PubChem CID: 164621881
Max Phase: Preclinical
Molecular Formula: C26H28N2O5
Molecular Weight: 448.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)COc2ccc(C(=O)Nc3cccc(C)c3C)cc2)cc1OC
Standard InChI: InChI=1S/C26H28N2O5/c1-17-6-5-7-22(18(17)2)28-26(30)20-9-11-21(12-10-20)33-16-25(29)27-15-19-8-13-23(31-3)24(14-19)32-4/h5-14H,15-16H2,1-4H3,(H,27,29)(H,28,30)
Standard InChI Key: QIKOVIBDAOTPED-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
30.8384 -17.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5480 -17.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5480 -16.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8366 -16.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1303 -16.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1303 -17.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4223 -17.7282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7149 -17.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4241 -16.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4241 -15.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2564 -17.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9635 -17.3175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6718 -17.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3789 -17.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0872 -17.7227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7943 -17.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4998 -17.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2055 -17.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2055 -16.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4922 -16.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7943 -16.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9121 -16.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9121 -15.2658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6210 -16.4895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3275 -16.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0335 -16.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7395 -16.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7395 -15.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0237 -14.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3275 -15.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4482 -16.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0335 -17.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6718 -18.5421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
6 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
26 32 1 0
13 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1998AlogP: 4.27#Rotatable Bonds: 9Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.23CX Basic pKa: ┄CX LogP: 4.24CX LogD: 4.24Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.38
References 1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M.. (2021) Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor., 64 (19.0): [PMID:34542289 ] [10.1021/acs.jmedchem.1c00972 ]