(S)-N-((2S,3R)-4-(4-amino-N-isobutylphenylsulfonamido)-3-hydroxy-1-phenylbutan-2-yl)piperidine-3-carboxamide

ID: ALA4868416

PubChem CID: 164624195

Max Phase: Preclinical

Molecular Formula: C26H38N4O4S

Molecular Weight: 502.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H]1CCCNC1)S(=O)(=O)c1ccc(N)cc1

Standard InChI:  InChI=1S/C26H38N4O4S/c1-19(2)17-30(35(33,34)23-12-10-22(27)11-13-23)18-25(31)24(15-20-7-4-3-5-8-20)29-26(32)21-9-6-14-28-16-21/h3-5,7-8,10-13,19,21,24-25,28,31H,6,9,14-18,27H2,1-2H3,(H,29,32)/t21-,24-,25+/m0/s1

Standard InChI Key:  GFVONONAIXMHFG-GVXSCFBNSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   20.9911   -9.3152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4038  -10.0250    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.8122   -9.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0066  -10.4213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0066  -11.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7160  -11.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4254  -11.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4254  -10.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7160  -10.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1384  -10.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1408   -9.1934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8450  -10.4254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5580  -10.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2686  -10.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5604   -9.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2734   -8.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9839   -9.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6965   -8.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6993   -7.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9837   -7.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2741   -7.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2662  -11.2509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9816  -10.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6923  -10.4337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6899  -11.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1159  -10.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1085  -11.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8183  -11.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5282  -11.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5280  -10.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8217  -10.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2771  -11.9607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4599  -11.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6816  -12.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2362  -11.6723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  1
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  1
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  1
 14 23  1  0
 23 24  1  0
 24 25  1  0
 24  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 32 33  1  0
 32 34  1  0
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868416

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 protease (9113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.68Molecular Weight (Monoisotopic): 502.2614AlogP: 2.00#Rotatable Bonds: 11
Polar Surface Area: 124.76Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.84CX Basic pKa: 9.60CX LogP: 2.17CX LogD: 0.00
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -0.57

References

1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y..  (2021)  Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants.,  220  [PMID:33906049] [10.1016/j.ejmech.2021.113450]

Source