1-(3-(aminomethyl)phenyl)-N-(5-((cyclopropylmethoxy)(phenyl)methyl)-2-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA4868429

PubChem CID: 118355729

Max Phase: Preclinical

Molecular Formula: C29H26F4N4O2

Molecular Weight: 538.55

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  NCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)Nc2cc(C(OCC3CC3)c3ccccc3)ccc2F)c1

Standard InChI:  InChI=1S/C29H26F4N4O2/c30-23-12-11-21(27(39-17-18-9-10-18)20-6-2-1-3-7-20)14-24(23)35-28(38)25-15-26(29(31,32)33)36-37(25)22-8-4-5-19(13-22)16-34/h1-8,11-15,18,27H,9-10,16-17,34H2,(H,35,38)

Standard InChI Key:  HIMJVDQVZQMIPM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   36.8566   -5.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8555   -6.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5703   -6.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2867   -6.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2839   -5.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5685   -5.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0019   -6.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7157   -6.5662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5660   -4.5038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2261   -4.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9688   -3.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1438   -3.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8913   -4.0200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6568   -2.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9901   -1.8140    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.8366   -2.6574    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0664   -1.9791    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.0121   -4.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1882   -5.0726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6222   -3.7111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4082   -3.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5808   -4.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3661   -5.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9770   -4.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7975   -3.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0125   -3.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5417   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9315   -6.3779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.3276   -6.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5014   -6.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2864   -7.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8977   -6.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7185   -5.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9337   -5.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1070   -7.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4967   -7.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6924   -7.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2476   -8.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8324   -2.5994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 28 35  1  0
 35 36  1  0
 37 36  1  0
 38 37  1  0
 36 38  1  0
 26 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4868429

   1-(3-(Aminomethyl)phenyl)-N-(5-((cyclopropylmethoxy)(phenyl)methyl)-2-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 538.55

Molecular Weight (Monoisotopic): 538.1992

AlogP: 6.26

#Rotatable Bonds: 9

Polar Surface Area: 82.17

Molecular Species: BASE

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 13.33

CX Basic pKa: 9.25

CX LogP: 6.04

CX LogD: 4.22

Aromatic Rings: 4

Heavy Atoms: 39

QED Weighted: 0.25

Np Likeness Score: -1.45

References

1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS..  (2021)  Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE).,  64  (17.0): [PMID:34436898] [10.1021/acs.jmedchem.1c00511]

2. Zhang W, Vadlakonda S, Wu M, Chintareddy V, Vogeti LN, Juarez L, Muppa S, Parker C, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P..  (2022)  Discovery and optimization of orally bioavailable and potent plasma Kallikrein inhibitors bearing a quaternary carbon.,  73  [PMID:36208543] [10.1016/j.bmc.2022.117035]

3. Xie Z, Li Z, Shao Y, Liao C..  (2020)  Discovery and development of plasma kallikrein inhibitors for multiple diseases.,  190  [PMID:32066009] [10.1016/j.ejmech.2020.112137]

Source

Source(1):

• Scientific Literature