The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-Carboxybenzyl)oxy)-2-(3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamido)benzo[d]thiazole-6-carboxylic acid ID: ALA4868482
PubChem CID: 147475197
Max Phase: Preclinical
Molecular Formula: C22H15Cl2N3O6S
Molecular Weight: 520.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)Nc2nc3c(OCc4ccc(C(=O)O)cc4)cc(C(=O)O)cc3s2)c(Cl)c1Cl
Standard InChI: InChI=1S/C22H15Cl2N3O6S/c1-9-15(23)16(24)18(25-9)19(28)27-22-26-17-13(6-12(21(31)32)7-14(17)34-22)33-8-10-2-4-11(5-3-10)20(29)30/h2-7,25H,8H2,1H3,(H,29,30)(H,31,32)(H,26,27,28)
Standard InChI Key: FCNZGVOVQZPBMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
25.4159 -3.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1324 -3.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1295 -2.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4141 -2.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7012 -3.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7024 -2.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9144 -2.4868 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.4261 -3.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9124 -3.8280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6041 -3.1556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1927 -2.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3677 -2.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6061 -1.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8838 -1.7675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0989 -2.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0977 -2.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8820 -3.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4291 -3.3334 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.8424 -2.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5584 -2.7368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8392 -1.5020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1344 -3.8893 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.4321 -1.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4116 -4.8128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1238 -5.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1194 -6.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4010 -6.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3962 -7.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1089 -7.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8280 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8293 -6.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1057 -8.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3897 -8.9376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8186 -8.9433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
16 18 1 0
3 19 1 0
19 20 1 0
19 21 2 0
17 22 1 0
15 23 1 0
1 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.35Molecular Weight (Monoisotopic): 519.0059AlogP: 5.47#Rotatable Bonds: 7Polar Surface Area: 141.61Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.46CX Basic pKa: ┄CX LogP: 5.18CX LogD: -1.29Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.27
References 1. Durcik M, Nyerges Á, Skok Ž, Skledar DG, Trontelj J, Zidar N, Ilaš J, Zega A, Cruz CD, Tammela P, Welin M, Kimbung YR, Focht D, Benek O, Révész T, Draskovits G, Szili PÉ, Daruka L, Pál C, Kikelj D, Mašič LP, Tomašič T.. (2021) New dual ATP-competitive inhibitors of bacterial DNA gyrase and topoisomerase IV active against ESKAPE pathogens., 213 [PMID:33524686 ] [10.1016/j.ejmech.2021.113200 ]