The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rac-(2S)-2,4-dibenzyl-N-(tert-butyl)-7-nitro-3-oxo-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine-5-carboxamide ID: ALA4868532
PubChem CID: 164621015
Max Phase: Preclinical
Molecular Formula: C28H30N4O4
Molecular Weight: 486.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)NC(=O)C1c2cc([N+](=O)[O-])ccc2N[C@@H](Cc2ccccc2)C(=O)N1Cc1ccccc1
Standard InChI: InChI=1S/C28H30N4O4/c1-28(2,3)30-26(33)25-22-17-21(32(35)36)14-15-23(22)29-24(16-19-10-6-4-7-11-19)27(34)31(25)18-20-12-8-5-9-13-20/h4-15,17,24-25,29H,16,18H2,1-3H3,(H,30,33)/t24-,25?/m0/s1
Standard InChI Key: GEVPHJPVYOVAOR-SKCDSABHSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.7063 -0.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2977 -1.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1188 -1.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9881 -3.7413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7266 -4.1040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9033 -4.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5596 -5.5341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3819 -5.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0555 -4.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2473 -4.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6504 -3.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8615 -3.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6729 -4.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2712 -5.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9972 -2.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7136 -2.5152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2900 -2.4995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5919 -1.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7023 -5.0943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7330 -6.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5513 -6.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8954 -7.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7130 -7.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1852 -6.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8299 -5.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0134 -5.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3737 -3.5955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1361 -3.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2499 -4.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0115 -5.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6554 -4.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5369 -3.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7753 -3.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2704 -3.1874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4594 -2.3882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4832 -3.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
10 4 1 0
4 5 1 0
5 6 1 0
9 7 1 0
6 8 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
4 15 1 0
15 16 2 0
15 17 1 0
17 2 1 0
2 18 1 0
6 19 2 0
8 20 1 6
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
5 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
34 35 1 0
34 36 2 0
12 34 1 0
M CHG 2 34 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.57Molecular Weight (Monoisotopic): 486.2267AlogP: 4.62#Rotatable Bonds: 6Polar Surface Area: 104.58Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.67CX Basic pKa: ┄CX LogP: 4.37CX LogD: 4.37Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.64
References 1. Vézina-Dawod S, Perreault M, Guay LD, Gerber N, Gobeil S, Biron E.. (2021) Synthesis and biological evaluation of novel 1,4-benzodiazepin-3-one derivatives as potential antitumor agents against prostate cancer., 45 [PMID:34333393 ] [10.1016/j.bmc.2021.116314 ]